BACK Mascot image.
← MA0 0 · Math Prepa for University

Lesson 5

Trigonometric Functions, and Identities

Radians, arcs and sectors, the circular functions of any angle and their graphs, the sine and cosine rules, trigonometric equations, the standard identities, small angles and further properties of triangles.

Taught

Measuring Angles

Measurement of Rotation

When a line OPOP is pivoted at OO and rotates from its initial position OP0OP_0 to a new position OP1OP_1, the angle P0OP1P_0OP_1 is a measure of the rotation of OPOP.

OP0P1θ
Figure 5.1. The angle θ\theta measures the rotation of OPOP from OP0OP_0 to OP1OP_1.

The angle θ\theta is usually measured in one of two units.

The Degree

The ancient Babylonian mathematicians, who thought that the solar year was 360360 days long, divided one complete revolution into 360360 equal parts, each part now being known as one degree, 11^\circ. Using the degree as the unit of rotation, half a revolution corresponds to 180180^\circ and a quarter of a revolution, that is a right angle, corresponds to 9090^\circ.

Angles smaller than a degree are usually given as decimal parts, so that half a degree is 0.50.5^\circ. In some fields, such as navigation, a degree is divided into 6060 minutes, written 6060', and each minute into 6060 seconds, written 6060''.

The Radian

Definition 5.1 (Radian).

If an arc PP1PP_1 of a circle with centre OO is equal in length to the radius of the circle, the angle POP1POP_1 is one radian, written 1c1^{\mathrm{c}}.

OPP1rrr1 rad
Figure 5.2. An arc equal in length to the radius subtends one radian at the centre.

The number of radians in one complete revolution is therefore

circumferenceradius=2πrr=2π,\frac{\text{circumference}}{\text{radius}} = \frac{2\pi r}{r} = 2\pi,

since the circumference of a circle of radius rr is 2πr2\pi r. So

2π radians=360,π radians=180,π2 radians=90.2\pi \text{ radians} = 360^\circ, \qquad \pi \text{ radians} = 180^\circ, \qquad \frac{\pi}{2} \text{ radians} = 90^\circ .

When an angle is quoted in terms of π\pi it is normal to omit the radian symbol, so we write 180=π180^\circ = \pi, not πc\pi^{\mathrm{c}}.

Angles which are simple fractions of 180180^\circ are easily expressed in radians in terms of π\pi, using 180=π180^\circ = \pi, and conversely:

60=60×π180=π3,135=135×π180=3π4,7π6=7π6×180π=210,5π3=5π3×180π=300.\begin{aligned} 60^\circ &= 60 \times \frac{\pi}{180} = \frac{\pi}{3}, & 135^\circ &= 135 \times \frac{\pi}{180} = \frac{3\pi}{4}, \\ \frac{7\pi}{6} &= \frac{7\pi}{6} \times \frac{180^\circ}{\pi} = 210^\circ, & \frac{5\pi}{3} &= \frac{5\pi}{3} \times \frac{180^\circ}{\pi} = 300^\circ . \end{aligned}

Converting in this way is not convenient for angles which are not simple fractions of a revolution. It would not be easy, for instance, to express 473447^\circ 34' as a multiple of π\pi. We would first have to express 3434' as a decimal part of a degree, 34=0.56734' = 0.567^\circ, and then use

47.567=47.567×π180=0.830 radians.47.567^\circ = 47.567 \times \frac{\pi}{180} = 0.830 \text{ radians}.

Calculations like this are tedious, and a calculator which offers the conversion avoids them.

To visualise the size of an angle of one radian, it helps to remember that π\pi radians =180= 180^\circ and that π=3.14\pi = 3.14 to two decimal places, so

1 radian=1803.14=57.3to three significant figures,1 \text{ radian} = \frac{180^\circ}{3.14} = 57.3^\circ \quad\text{to three significant figures},

a little less than 6060^\circ.

Problem 5.1.

  1. Without a calculator, express 3030^\circ, 270270^\circ and 22.522.5^\circ in radians, in terms of π\pi.
  2. Without a calculator, express 5π6\dfrac{5\pi}{6}, 11π6\dfrac{11\pi}{6} and 4π9\dfrac{4\pi}{9} in degrees.
  3. Express 544554^\circ 45' in radians, and 2.862.86 radians in degrees and minutes.

The Circular Functions

The Ratios of an Acute Angle

For any acute angle θ\theta there are six trigonometric ratios, each of which is defined by referring to a right-angled triangle containing θ\theta.

OABθ
Figure 5.3. A right-angled triangle OABOAB containing the acute angle θ\theta at OO.

Definition 5.2 (Trigonometric Ratios of an Acute Angle).

In a triangle OABOAB with a right angle at AA and an acute angle θ\theta at OO,

sinθ=ABOB,cosecθ=OBAB,cosθ=OAOB,secθ=OBOA,tanθ=ABOA,cotθ=OAAB.\begin{aligned} \sin\theta &= \frac{AB}{OB}, &\quad \operatorname{cosec}\theta &= \frac{OB}{AB}, \\ \cos\theta &= \frac{OA}{OB}, &\quad \sec\theta &= \frac{OB}{OA}, \\ \tan\theta &= \frac{AB}{OA}, &\quad \cot\theta &= \frac{OA}{AB} . \end{aligned}

These are the sine, cosine, tangent, cosecant, secant and cotangent of θ\theta.

Each ratio has a single value for any one acute angle, since all right-angled triangles containing θ\theta are similar, and the values are available from a calculator.

Length of an Arc and Area of a Sector

The circumference of a circle of radius rr is 2πr2\pi r and its area is πr2\pi r^2, and these formulae can be used to derive further results.

Consider an arc which subtends an angle θ\theta at the centre of the circle, where θ\theta is measured in radians. From the definition of a radian, the arc which subtends 11 radian at the centre has length rr, so an arc which subtends θ\theta radians at the centre has length rθr\theta.

The area of a sector containing an angle of θ\theta radians at the centre can be found by regarding the sector as a fraction of the circle. The ratio of the area of the sector to the area of the circle is equal to the ratio of the angle θ\theta contained in the sector to the angle 2π2\pi contained in the whole circle, that is

area of sectorπr2=θ2π,soarea of sector=12r2θ.\frac{\text{area of sector}}{\pi r^2} = \frac{\theta}{2\pi}, \qquad\text{so}\qquad \text{area of sector} = \tfrac12 r^2\theta .
ABOθrrθ
Figure 5.4. A sector AOBAOB containing the angle θ\theta at the centre OO.

Hence if an arc ABAB subtends an angle of θ\theta radians at the centre OO of a circle of radius rr,

length of arc AB=rθ,area of sector AOB=12r2θ.\text{length of arc } AB = r\theta, \qquad \text{area of sector } AOB = \tfrac12 r^2\theta .

Example 5.3.

A railway line changes direction by 2020^\circ when passing round a circular arc of length 500500 m. What is the radius of the arc?

The line turns through the angle which the arc subtends at the centre, and in radians 20=20×π180=π920^\circ = 20 \times \dfrac{\pi}{180} = \dfrac{\pi}{9}. Using length of arc =rθ= r\theta, with θ\theta in radians,

500=r×π9,sor=4500π=1432.500 = r \times \frac{\pi}{9}, \qquad\text{so}\qquad r = \frac{4500}{\pi} = 1432 .

The radius of the track is therefore 14321432 m.

Example 5.4.

A chord ABAB divides a circle of radius 22 m into two segments. If ABAB subtends an angle of 6060^\circ at the centre OO of the circle, find the area of the minor segment.

The triangle AOBAOB has base OA=2OA = 2 and height 2sin602\sin 60^\circ, so

area of triangle AOB=12×2×2sin60=1.732 m2.\text{area of triangle } AOB = \tfrac12 \times 2 \times 2\sin 60^\circ = 1.732\ \text{m}^2 .

Since 60=π360^\circ = \dfrac{\pi}{3} radians,

area of sector AOB=12×22×π3=2π3=2.094 m2.\text{area of sector } AOB = \tfrac12 \times 2^2 \times \frac{\pi}{3} = \frac{2\pi}{3} = 2.094\ \text{m}^2 .

So the area of the minor segment, shaded in Figure 5.5, is (2.0941.732) m2=0.362 m2(2.094 - 1.732)\ \text{m}^2 = 0.362\ \text{m}^2.

ABO60°2 m
Figure 5.5. The minor segment cut off by a chord subtending 6060^\circ at the centre.

Example 5.5.

Two discs of radii 33 cm and 44 cm are laid on a table with their centres 55 cm apart. Find the perimeter of the figure-eight shape so formed.

Let the discs have their centres at AA and BB and cross at CC. Since 52=32+425^2 = 3^2 + 4^2, the triangle ABCABC is right-angled at CC. Let α\alpha be the angle CABCAB and β\beta the angle CBACBA. Then

tanα=43,α=53.13=0.927 radians,β=90α=36.87=0.644 radians.\tan\alpha = \tfrac43, \quad \alpha = 53.13^\circ = 0.927 \text{ radians}, \qquad \beta = 90^\circ - \alpha = 36.87^\circ = 0.644 \text{ radians}.

The perimeter is made up of an arc subtending 2π2α2\pi - 2\alpha radians in the circle of radius 33 cm and an arc subtending 2π2β2\pi - 2\beta radians in the circle of radius 44 cm. Hence, using length of arc =rθ= r\theta,

perimeter=3(6.2831.854)+4(6.2831.287)=33.3 cm.\text{perimeter} = 3(6.283 - 1.854) + 4(6.283 - 1.287) = 33.3 \text{ cm}.
ABCαβ345
Figure 5.6. The figure-eight formed by the two discs, with its perimeter drawn heavily.

Problem 5.2.

  1. The moon subtends an angle of 3131' at the earth, and its distance from the earth is 382100382\,100 km. Find the diameter of the moon in kilometres.
  2. An arc ABAB of length 55 cm is marked on a circle of radius 33 cm. Find the area of the sector bounded by this arc and the radii to AA and BB.
  3. A chord ABAB of length 5.25.2 cm subtends an angle of 120120^\circ at the centre of a circle. Calculate the length of the arc ABAB, the area of the sector containing the angle of 120120^\circ, and the area of the minor segment cut off by ABAB.

The Ratios of a General Angle

Since we now regard an angle as the measure of the rotation of a line about a fixed point, the size of an angle is unlimited, because the line can keep on rotating indefinitely. The six trigonometric ratios, however, have so far been given a meaning only for acute angles, since each is defined by an angle in a right-angled triangle. To use them for angles of any size they must be defined in a more general way.

The system of reference in which a general angle is measured is very similar to that used for polar coordinates. The point about which the line OPOP rotates is the pole or origin OO, and the position from which the angle is measured is the initial line, the xx-axis. An angle formed when the line rotates anticlockwise is positive, while clockwise rotation gives a negative angle. The pair of Cartesian axes divides the plane into four quadrants, numbered 11, 22, 33 and 44 as in Figure 5.7.

xy1234Pθanticlockwise: θ positivexyPθclockwise: θ negative
Figure 5.7. The four quadrants, and the positive and negative senses of rotation.

As the line OPOP rotates, PP moves round the first quadrant, where both its coordinates are positive. As OPOP moves into the second quadrant its xx-coordinate becomes negative. In the third quadrant both coordinates of PP are negative, and in the fourth quadrant the xx-coordinate is positive and the yy-coordinate negative. The length rr of OPOP, the radius vector, is always taken to be positive.

Definition 5.6 (Trigonometric Ratios of Any Angle).

If the line OPOP has rotated through the angle θ\theta from the positive xx-axis, and PP is the point (x,y)(x, y) with OP=rOP = r, then

sinθ=yr,cosθ=xr,tanθ=yx,\sin\theta = \frac{y}{r}, \qquad \cos\theta = \frac{x}{r}, \qquad \tan\theta = \frac{y}{x},

and cosecθ=ry\operatorname{cosec}\theta = \dfrac{r}{y}, secθ=rx\sec\theta = \dfrac{r}{x}, cotθ=xy\cot\theta = \dfrac{x}{y}, each ratio being defined whenever its denominator is not zero.

For an acute angle these agree with the ratios of the right-angled triangle formed by OO, PP and the foot of the perpendicular from PP to the xx-axis.

The numerical values of the ratios can be found as follows. From any position of PP, the perpendicular from PP meeting the xx-axis at QQ forms a right-angled triangle OPQOPQ. The angle POQPOQ formed in this way is always acute, whatever the value of θ\theta, and is called the associated acute angle, α\alpha. For a particular value of θ\theta, α\alpha is the difference between θ\theta and 180180^\circ or 360360^\circ, or a further multiple of 180180^\circ for larger angles. For example

θ=160:α=180160=20,θ=7π6:α=7π6π=π6,θ=275:α=360275=85,θ=517:α=540517=23.\begin{aligned} \theta &= 160^\circ: & \alpha &= 180^\circ - 160^\circ = 20^\circ, &\qquad \theta &= \tfrac{7\pi}{6}: & \alpha &= \tfrac{7\pi}{6} - \pi = \tfrac{\pi}{6}, \\ \theta &= 275^\circ: & \alpha &= 360^\circ - 275^\circ = 85^\circ, &\qquad \theta &= 517^\circ: & \alpha &= 540^\circ - 517^\circ = 23^\circ . \end{aligned}
xyαP(x, y)Q1st quadrant: α = θxyαP(x, y)Q2nd quadrant: α = 180° − θxyαP(x, y)Q3rd quadrant: α = θ − 180°xyαP(x, y)Q4th quadrant: α = 360° − θ
Figure 5.8. The associated acute angle α\alpha when PP is in each of the four quadrants.

In the triangle OPQOPQ the lengths PQPQ and OQOQ are rsinαr\sin\alpha and rcosαr\cos\alpha, so the ratios of θ\theta have the numerical values of the ratios of α\alpha, and their signs depend on the signs of xx and yy, that is on the quadrant into which PP has rotated.

  1. In the first quadrant all six ratios are positive, and since θ\theta is acute their values are those of θ\theta itself. If OPOP has rotated through more than a complete revolution, α=θ360\alpha = \theta - 360^\circ.
  2. In the second quadrant α=180θ\alpha = 180^\circ - \theta. The sine ratio yr\dfrac{y}{r} is positive, the cosine ratio xr\dfrac{x}{r} is negative and the tangent ratio yx\dfrac{y}{x} is negative, so sinθ=+sinα\sin\theta = +\sin\alpha, cosθ=cosα\cos\theta = -\cos\alpha and tanθ=tanα\tan\theta = -\tan\alpha.
  3. In the third quadrant α=θ180\alpha = \theta - 180^\circ. The tangent ratio is positive while the sine and cosine ratios are both negative, so sinθ=sinα\sin\theta = -\sin\alpha, cosθ=cosα\cos\theta = -\cos\alpha and tanθ=+tanα\tan\theta = +\tan\alpha.
  4. In the fourth quadrant α=360θ\alpha = 360^\circ - \theta. The cosine ratio is positive but the sine and tangent ratios are negative, so sinθ=sinα\sin\theta = -\sin\alpha, cosθ=+cosα\cos\theta = +\cos\alpha and tanθ=tanα\tan\theta = -\tan\alpha.

These results are summarised in the quadrant diagrams of Figure 5.9. The second shows in each quadrant the ratios which are positive there: all of them in the first, the sine in the second, the tangent in the third and the cosine in the fourth. The quadrant rule, together with the value of the associated acute angle, gives the value of any trigonometric ratio of any angle.

s +c +t +s +c −t −s −c −t +s −c +t −(i) the signsASTC(ii) the ratios that are positive
Figure 5.9. Quadrant diagrams for the signs of the sine, cosine and tangent.

Negative Angles

If OPOP rotates clockwise, so that PP moves through the quadrants in the reverse order, 4th, 3rd, 2nd, 1st, then θ\theta is negative. Every position of OPOP can be reached either by anticlockwise or by clockwise rotation, and so corresponds to two different values of θ\theta, one positive and one negative. For example, θ=+120\theta = +120^\circ and θ=240\theta = -240^\circ give the same position, with α=60\alpha = 60^\circ in both cases, so the angles +120+120^\circ and 240-240^\circ have the same trigonometric ratios. PP is in the second quadrant, where only the sine ratio is positive, hence

sin120=sin(240)=+sin60,cos120=cos(240)=cos60,tan120=tan(240)=tan60.\begin{aligned} \sin 120^\circ &= \sin(-240^\circ) = +\sin 60^\circ, \\ \cos 120^\circ &= \cos(-240^\circ) = -\cos 60^\circ, \\ \tan 120^\circ &= \tan(-240^\circ) = -\tan 60^\circ . \end{aligned}
xyP+120°−240°
Figure 5.10. The same position of OPOP reached by rotations of +120+120^\circ and 240-240^\circ.

Turning through θ-\theta instead of θ\theta reflects PP in the xx-axis, which changes the sign of yy and leaves xx unchanged. So for every angle

sin(θ)=sinθ,cos(θ)=cosθ,tan(θ)=tanθ.\sin(-\theta) = -\sin\theta, \qquad \cos(-\theta) = \cos\theta, \qquad \tan(-\theta) = -\tan\theta .

Example 5.7.

Find the sine, cosine and tangent of 243243^\circ.

Here θ=243\theta = 243^\circ and α=θ180=63\alpha = \theta - 180^\circ = 63^\circ. PP is in the third quadrant, where only the tangent ratio is positive, so

sin243=sin63=0.8910,cos243=cos63=0.4540,tan243=+tan63=1.9626.\sin 243^\circ = -\sin 63^\circ = -0.8910, \qquad \cos 243^\circ = -\cos 63^\circ = -0.4540, \qquad \tan 243^\circ = +\tan 63^\circ = 1.9626 .

Example 5.8.

If cosθ=0.866\cos\theta = 0.866 and tanθ\tan\theta is negative, find sinθ\sin\theta.

θ\theta is in a quadrant where the cosine ratio is positive and the tangent ratio is negative, that is in the fourth quadrant, where α=360θ\alpha = 360^\circ - \theta. Now cosα=0.866\cos\alpha = 0.866 gives α=30\alpha = 30^\circ, so θ=330\theta = 330^\circ. In the fourth quadrant the sine ratio is negative, therefore

sinθ=sinα=sin30=0.5.\sin\theta = -\sin\alpha = -\sin 30^\circ = -0.5 .

Example 5.9.

Given that tanθ=1\tan\theta = 1 and 2πθ2π-2\pi \leqslant \theta \leqslant 2\pi, give four possible values of θ\theta.

The tangent ratio is positive in the first and third quadrants. When tanα=1\tan\alpha = 1, α=π4\alpha = \dfrac{\pi}{4}, or 4545^\circ. The range of values of θ\theta is specified in radians, so the solution should also be given in radians:

θ=π4,5π4,3π4or7π4.\theta = \frac{\pi}{4}, \qquad \frac{5\pi}{4}, \qquad -\frac{3\pi}{4} \qquad\text{or}\qquad -\frac{7\pi}{4} .

In this example we are solving a simple trigonometric equation.

Example 5.10.

An angle θ\theta has an associated acute angle of 5353^\circ. Find sinθ\sin\theta.

Only α\alpha is given, so θ\theta could be in any of the four quadrants. In quadrants 11 and 22, sinθ=sin53=0.7986\sin\theta = \sin 53^\circ = 0.7986, and in quadrants 33 and 44, sinθ=sin53=0.7986\sin\theta = -\sin 53^\circ = -0.7986. Therefore sinθ=±0.7986\sin\theta = \pm 0.7986.

Problem 5.3.

  1. Find the sine, cosine and tangent of 300300^\circ and of 160-160^\circ in terms of the ratios of their associated acute angles, and evaluate them.
  2. Within the range 360θ360-360^\circ \leqslant \theta \leqslant 360^\circ, give all the values of θ\theta for which cosθ=0.5\cos\theta = -0.5, and all those for which tanθ=1.2\tan\theta = 1.2.
  3. Find the smallest angle, positive or negative, for which cosθ=0.8\cos\theta = 0.8 and sinθ\sin\theta is positive, and the smallest for which sinθ=0.6\sin\theta = -0.6 and tanθ\tan\theta is negative.

Solving Triangles

Triangles are involved in many practical measurements, in surveying for instance. A triangle has three sides and three angles, and its size and shape can be specified by suitable data, such as three sides, two angles and a side, or two sides and their included angle. The third angle is not an independent item: the angles of a triangle add up to 180180^\circ, so if two of them are known the third follows directly. Two sides and a non-included angle can sometimes give two different triangles. From any data sufficient to define a triangle the remaining sides and angles can be calculated. This is called solving the triangle, and it uses one of the formulae that relate the sides and angles of a triangle. The two used most frequently are the sine rule and the cosine rule.

In a triangle ABCABC we use AA, BB and CC to denote the angles at the vertices AA, BB and CC, and aa, bb and cc to denote the sides opposite these vertices.

The Sine Rule

In a triangle ABCABC,

asinA=bsinB=csinC.\frac{a}{\sin A} = \frac{b}{\sin B} = \frac{c}{\sin C} .

We show this by taking OO and RR as the centre and the radius of the circle through AA, BB and CC, drawing the diameter ADAD and joining DBDB, as in Figure 5.11. Then ABD=90\angle ABD = 90^\circ, the angle in a semicircle, so in the right-angled triangle ABDABD, whose hypotenuse ADAD is 2R2R,

c=2RsinD.c = 2R\sin D .

In diagram (i), C=DC = D, since they are angles in the same segment. In diagram (ii), C=180DC = 180^\circ - D, since they are opposite angles of a cyclic quadrilateral, and so sinC=sinD\sin C = \sin D by the rule for the second quadrant. In both diagrams, therefore, sinC=sinD\sin C = \sin D, and hence

c=2RsinC,that iscsinC=2R.c = 2R\sin C, \qquad\text{that is}\qquad \frac{c}{\sin C} = 2R .

Similarly bsinB=2R\dfrac{b}{\sin B} = 2R and asinA=2R\dfrac{a}{\sin A} = 2R, so

asinA=bsinB=csinC=2R.\frac{a}{\sin A} = \frac{b}{\sin B} = \frac{c}{\sin C} = 2R .
OABCD(i) C and D on the same side of ABOABCD(ii) C and D on opposite sides
Figure 5.11. The circle through AA, BB and CC, with the diameter ADAD.

Any pair of these three equal ratios gives an equation containing two sides and two angles. So the sine rule can be used to solve a triangle in which we know either two sides and one angle, or two angles and one side, provided that one given side is opposite a given angle.

Example 5.11.

In a triangle ABCABC, A=73A = 73^\circ, B=49B = 49^\circ and a=12.2a = 12.2 cm. Find bb and cc.

As aa, AA and BB are known, bb can be calculated using

bsinB=asinA,b=12.2sin49sin73=9.63 cm.\frac{b}{\sin B} = \frac{a}{\sin A}, \qquad b = \frac{12.2\sin 49^\circ}{\sin 73^\circ} = 9.63 \text{ cm}.

Also C=1807349=58C = 180^\circ - 73^\circ - 49^\circ = 58^\circ, so cc can be calculated using

csinC=asinA,c=12.2sin58sin73=10.82 cm.\frac{c}{\sin C} = \frac{a}{\sin A}, \qquad c = \frac{12.2\sin 58^\circ}{\sin 73^\circ} = 10.82 \text{ cm}.

In this example the given data define one and only one triangle.

The Ambiguous Case

Sometimes, when two sides and one angle are specified, two different triangles can be found from the data. Suppose that we have to solve the triangle in which A=24A = 24^\circ, c=2.6c = 2.6 cm and a=1.1a = 1.1 cm. Knowing aa, AA and cc we can find CC using

asinA=csinC,sinC=2.6sin241.1=0.9614.\frac{a}{\sin A} = \frac{c}{\sin C}, \qquad \sin C = \frac{2.6\sin 24^\circ}{1.1} = 0.9614 .

In a triangle, sinC=0.9614\sin C = 0.9614 gives C=74C = 74^\circ or C=106C = 106^\circ, since the sine is positive in both the first and the second quadrants. We must check whether both are possible values for CC.

  1. If C=74C = 74^\circ, then A+C=98A + C = 98^\circ, which is less than 180180^\circ. So 7474^\circ is a possible value for CC, corresponding to B=82B = 82^\circ.
  2. If C=106C = 106^\circ, then A+C=130A + C = 130^\circ, which is also less than 180180^\circ. So 106106^\circ is a possible value too, corresponding to B=50B = 50^\circ.

So there are two possible triangles with the given data. This is known as the ambiguous case, and it is easily understood by attempting to construct the triangle from its specification: an arc of radius 1.11.1 about BB cuts the line from AA in two places. Each position of CC corresponds to a different pair of values for BB and bb, and in each case the solution of the triangle is completed using asinA=bsinB\dfrac{a}{\sin A} = \dfrac{b}{\sin B}, which gives b=2.68b = 2.68 cm and b=2.07b = 2.07 cm.

ABC1C224°2.61.11.1
Figure 5.12. The two positions C1C_1 and C2C_2 of the vertex CC in the ambiguous case.

There are not always two possible triangles when one angle and two sides are given, as the next example shows.

Example 5.12.

If A=37A = 37^\circ, a=4.59a = 4.59 cm and c=2.1c = 2.1 cm, show that there is only one possible triangle ABCABC, and find its remaining angles.

Using asinA=csinC\dfrac{a}{\sin A} = \dfrac{c}{\sin C},

sinC=2.1sin374.59=0.2753,soC=16 or C=164.\sin C = \frac{2.1\sin 37^\circ}{4.59} = 0.2753, \qquad\text{so}\qquad C = 16^\circ \ \text{or}\ C = 164^\circ .

If C=16C = 16^\circ and A=37A = 37^\circ, then A+C=53A + C = 53^\circ, which is less than 180180^\circ, so 1616^\circ is a possible value for CC, corresponding to B=127B = 127^\circ. If C=164C = 164^\circ, then A+C=201A + C = 201^\circ, which is more than 180180^\circ, so 164164^\circ is not a possible value. Hence there is only one triangle defined by the given data, and its other angles are C=16C = 16^\circ and B=127B = 127^\circ.

Problem 5.4.

In each part the data refer to a triangle in the standard notation.

  1. B=35B = 35^\circ, a=2.7a = 2.7 cm and b=5.1b = 5.1 cm; find AA.
  2. b=3.8b = 3.8 cm, A=25A = 25^\circ and a=1.8a = 1.8 cm; find the possible values of CC.
  3. In a triangle PQRPQR the angle PQRPQR is 3030^\circ and the angle QPRQPR is θ\theta. Show that sinθ=p2q\sin\theta = \dfrac{p}{2q}.

The Cosine Rule

The sine rule can be applied only when we know an angle opposite a given side. It cannot be used, for instance, when two sides and the included angle are given. Such cases are solved using the cosine rule,

a2=b2+c22bccosA.a^2 = b^2 + c^2 - 2bc\cos A .

We show this by placing the triangle ABCABC on Cartesian axes with AA at the origin and ABAB along the positive xx-axis, as in Figure 5.13. In diagram (i) the coordinates of BB and CC are (c,0)(c, 0) and (bcosA,bsinA)(b\cos A, b\sin A). In diagram (ii), where AA is obtuse, they are (c,0)(c, 0) and (bcos(180A),bsin(180A))\bigl(-b\cos(180^\circ - A), b\sin(180^\circ - A)\bigr), which by the rule for the second quadrant is again (bcosA,bsinA)(b\cos A, b\sin A). So by the length of the line joining two points,

a2=(bsinA)2+(bcosAc)2=b2sin2A+b2cos2A2bccosA+c2,a^2 = (b\sin A)^2 + (b\cos A - c)^2 = b^2\sin^2 A + b^2\cos^2 A - 2bc\cos A + c^2,

where sin2A\sin^2 A means (sinA)2(\sin A)^2. Since CC is at a distance bb from the origin, (bcosA)2+(bsinA)2=b2(b\cos A)^2 + (b\sin A)^2 = b^2, and therefore

a2=b2+c22bccosA.a^2 = b^2 + c^2 - 2bc\cos A .

Similarly it can be shown that

b2=c2+a22cacosB,c2=a2+b22abcosC.b^2 = c^2 + a^2 - 2ca\cos B, \qquad c^2 = a^2 + b^2 - 2ab\cos C .
xyAB (c, 0)Cabc(i) A acutexyAB (c, 0)Cabc(ii) A obtuse
Figure 5.13. The triangle ABCABC placed on axes, with AA acute and with AA obtuse.

The calculation involved in using the cosine rule is less straightforward than that required for the sine rule, so the cosine rule is used only when the sine rule is inapplicable.

Example 5.13.

In a triangle ABCABC, a=17.5a = 17.5 cm, b=8.4b = 8.4 cm and c=11.9c = 11.9 cm. Find the largest angle.

The longest side is opposite the largest angle, so we must find AA. As aa, bb and cc are given we use the cosine rule, rearranged so that AA can be found conveniently:

cosA=b2+c2a22bc=8.42+11.9217.522(8.4)(11.9)=0.4706.\cos A = \frac{b^2 + c^2 - a^2}{2bc} = \frac{8.4^2 + 11.9^2 - 17.5^2}{2(8.4)(11.9)} = -0.4706 .

Hence A=118.1A = 118.1^\circ, which is obtuse because cosA\cos A is negative.

When the solution of a triangle requires the cosine rule first, the remaining sides and angles can then be found using the sine rule.

Example 5.14.

Solve the triangle PQRPQR given that p=12.1p = 12.1 cm, q=7.3q = 7.3 cm and R=37.5R = 37.5^\circ.

We first use

r2=p2+q22pqcosR,which givesr=7.72 cm.r^2 = p^2 + q^2 - 2pq\cos R, \qquad\text{which gives}\qquad r = 7.72 \text{ cm}.

Now the sine rule can be used, since we know rr, RR and qq:

qsinQ=rsinR,sinQ=7.3sin37.57.72=0.5756.\frac{q}{\sin Q} = \frac{r}{\sin R}, \qquad \sin Q = \frac{7.3\sin 37.5^\circ}{7.72} = 0.5756 .

Hence Q=35.1Q = 35.1^\circ. QQ cannot be obtuse, as qq is not the longest side of the triangle. Finally P=180QR=107.4P = 180^\circ - Q - R = 107.4^\circ.

Problem 5.5.

  1. Solve the triangle in which a=4a = 4, b=7b = 7 and c=5c = 5.
  2. Using cosA=b2+c2a22bc\cos A = \dfrac{b^2 + c^2 - a^2}{2bc}, show that AA is acute if a2<b2+c2a^2 < b^2 + c^2 and obtuse if a2>b2+c2a^2 > b^2 + c^2, and check that taking A=90A = 90^\circ gives the result of Pythagoras.
  3. Find the angles of a triangle whose sides are in the ratio 2:3:42 : 3 : 4.

The Graphs of the Circular Functions

There is a single value for each trigonometric ratio of any angle, so the mappings θsinθ\theta \mapsto \sin\theta, θcosθ\theta \mapsto \cos\theta, and so on, are functions, and we can plot graphs showing how each trigonometric function behaves as θ\theta varies. The graphs of the sine, cosine and tangent are particularly important.

The Sine Function

−11θ−2π−3π/2−π−π/2π/2π3π/2
Figure 5.14. The graph of f(θ)=sinθf(\theta) = \sin\theta.

The graph of f:θsinθf : \theta \mapsto \sin\theta, θR\theta \in \RR, shows that the sine function has the following characteristics.

  1. It is continuous: its graph has no breaks.
  2. Its range is 1sinθ1-1 \leqslant \sin\theta \leqslant 1.
  3. The shape of the graph from θ=0\theta = 0 to θ=2π\theta = 2\pi is repeated for each further complete revolution.

Definition 5.15 (Periodic Function).

A function whose graph repeats a pattern is periodic, or cyclic. The width of the repeating pattern, measured on the horizontal axis, is the period of the function: it is the smallest positive number pp for which f(θ+p)=f(θ)f(\theta + p) = f(\theta) for every θ\theta.

So θsinθ\theta \mapsto \sin\theta is a periodic function with a period of 2π2\pi, a maximum value of 11 and a minimum value of 1-1. A graph of this shape is known as a sine wave. The amplitude is half the distance between the maximum and minimum values; for sinθ\sin\theta its value is 11.

The Cosine Function

−11θ−2π−3π/2−π−π/2π/2π3π/2
Figure 5.15. The graph of f(θ)=cosθf(\theta) = \cos\theta, with the sine curve dashed.

The characteristics of the graph of f:θcosθf : \theta \mapsto \cos\theta, θR\theta \in \RR, are as follows.

  1. It is continuous.
  2. It lies entirely within the range 1cosθ1-1 \leqslant \cos\theta \leqslant 1.
  3. It is periodic with a period of 2π2\pi.
  4. It has the same shape as the sine graph, but is displaced a distance π2\dfrac{\pi}{2} to the left on the horizontal axis. Such a displacement is known as a phase difference, or phase shift.

So θcosθ\theta \mapsto \cos\theta is a cyclic function with period 2π2\pi and values from 1-1 to 11.

The Tangent Function

−3−2−1123θ−2π−3π/2−π−π/2π/2π3π/2
Figure 5.16. The graph of f(θ)=tanθf(\theta) = \tan\theta.

The behaviour of the tangent function f:θtanθf : \theta \mapsto \tan\theta is different from that of the sine and cosine functions in several respects.

  1. It is not continuous, being undefined when θ=±π2,±3π2,±5π2,\theta = \pm\dfrac{\pi}{2}, \pm\dfrac{3\pi}{2}, \pm\dfrac{5\pi}{2}, \ldots, where the lines drawn dashed in Figure 5.16 are asymptotes to the curve.
  2. The range of possible values of tanθ\tan\theta is unlimited.
  3. The tangent function is periodic, but its period is π\pi, not 2π2\pi as for the sine and cosine.

Special Values

It is useful to note the angles whose trigonometric ratios have the values 00 and ±1\pm 1, and the angles at which tanθ\tan\theta is undefined. Reference to the graphs shows that, for nZn \in \ZZ,

sinθ=0when θ=,2π,π,0,π,2π,3π,,that is θ=nπ,sinθ=1when θ=,3π2,π2,5π2,,that is θ=2nπ+π2,sinθ=1when θ=,π2,3π2,7π2,,that is θ=2nππ2,cosθ=0when θ=,π2,π2,3π2,5π2,,that is θ=(2n+1)π2,cosθ=1when θ=,2π,0,2π,4π,,that is θ=2nπ,cosθ=1when θ=,π,π,3π,5π,,that is θ=(2n+1)π,tanθ=0when θ=,π,0,π,2π,,that is θ=nπ,\begin{aligned} \sin\theta &= 0 && \text{when } \theta = \ldots, -2\pi, -\pi, 0, \pi, 2\pi, 3\pi, \ldots, &&\text{that is } \theta = n\pi, \\ \sin\theta &= 1 && \text{when } \theta = \ldots, -\tfrac{3\pi}{2}, \tfrac{\pi}{2}, \tfrac{5\pi}{2}, \ldots, &&\text{that is } \theta = 2n\pi + \tfrac{\pi}{2}, \\ \sin\theta &= -1 && \text{when } \theta = \ldots, -\tfrac{\pi}{2}, \tfrac{3\pi}{2}, \tfrac{7\pi}{2}, \ldots, &&\text{that is } \theta = 2n\pi - \tfrac{\pi}{2}, \\ \cos\theta &= 0 && \text{when } \theta = \ldots, -\tfrac{\pi}{2}, \tfrac{\pi}{2}, \tfrac{3\pi}{2}, \tfrac{5\pi}{2}, \ldots, &&\text{that is } \theta = (2n + 1)\tfrac{\pi}{2}, \\ \cos\theta &= 1 && \text{when } \theta = \ldots, -2\pi, 0, 2\pi, 4\pi, \ldots, &&\text{that is } \theta = 2n\pi, \\ \cos\theta &= -1 && \text{when } \theta = \ldots, -\pi, \pi, 3\pi, 5\pi, \ldots, &&\text{that is } \theta = (2n + 1)\pi, \\ \tan\theta &= 0 && \text{when } \theta = \ldots, -\pi, 0, \pi, 2\pi, \ldots, &&\text{that is } \theta = n\pi, \end{aligned}

and tanθ\tan\theta is undefined, its graph going off to ±\pm\infty, when θ=(2n+1)π2\theta = (2n + 1)\dfrac{\pi}{2}.

Remark.

Throughout, 2n2n stands for any even integer and 2n+12n + 1 for any odd integer, provided that nZn \in \ZZ.

The Reciprocal Ratios

The three ratios sinθ\sin\theta, cosθ\cos\theta and tanθ\tan\theta are used much more frequently than their reciprocals cosecθ\operatorname{cosec}\theta, secθ\sec\theta and cotθ\cot\theta, but the reciprocal ratios must not be overlooked. The graph of f(θ)=cosecθf(\theta) = \operatorname{cosec}\theta can be drawn without any table of values, simply by observing the graph of f(θ)=sinθf(\theta) = \sin\theta and using the following properties of any expression and its reciprocal.

  1. As an expression approaches zero its reciprocal becomes numerically large without limit, and as an expression becomes numerically large without limit its reciprocal approaches zero.
  2. The reciprocal of 11 is 11, and the reciprocal of 1-1 is 1-1.
  3. Where an expression has a maximum value its reciprocal has a minimum value, and conversely.
  4. Where an expression is increasing its reciprocal is decreasing, and conversely.
  5. An expression and its reciprocal have the same sign.

These properties are reasonable enough to accept without detailed analysis at this stage.

−3−2−1123θ−π−π/2π/2π3π/2
Figure 5.17. The graph of f(θ)=cosecθf(\theta) = \operatorname{cosec}\theta for πθ2π-\pi \leqslant \theta \leqslant 2\pi, with the sine curve dashed.

In the same way the graphs of f(θ)=secθf(\theta) = \sec\theta and f(θ)=cotθf(\theta) = \cot\theta can be deduced from those of cosθ\cos\theta and tanθ\tan\theta.

−3−2−1123θ−π−π/2π/2π3π/2sec θ, with cos θ dashed−3−2−1123θ−π−π/2π/2π3π/2cot θ, with tan θ dashed
Figure 5.18. The graphs of secθ\sec\theta and cotθ\cot\theta, each drawn over the curve it is the reciprocal of.

Inverse Circular Functions

The function f:xsinxf : x \mapsto \sin x is a many-one mapping for the domain xRx \in \RR, and so it does not have an inverse function. However, if the domain is redefined as π2xπ2-\dfrac{\pi}{2} \leqslant x \leqslant \dfrac{\pi}{2}, the function f:xsinxf : x \mapsto \sin x is a one-one mapping, and now it does have an inverse. This inverse sine function is denoted by arcsin\arcsin or sin1\sin^{-1}. Thus

if f:xsinx, π2xπ2,thenf1:xarcsinx, 1x1.\text{if } f : x \mapsto \sin x, \ -\frac{\pi}{2} \leqslant x \leqslant \frac{\pi}{2}, \qquad\text{then}\qquad f^{-1} : x \mapsto \arcsin x, \ -1 \leqslant x \leqslant 1 .

For f:xsinxf : x \mapsto \sin x the input is an angle and the output is a number. So for the inverse function f1:xarcsinxf^{-1} : x \mapsto \arcsin x the input is a number and the output is an angle, and arcsinx\arcsin x means “the angle whose sine is xx”.

Similarly, if f:xcosxf : x \mapsto \cos x, 0xπ0 \leqslant x \leqslant \pi, then f1f^{-1} exists and is denoted by arccos\arccos or cos1\cos^{-1}, where arccosx\arccos x means “the angle whose cosine is xx”:

if f:xcosx, 0xπ,thenf1:xarccosx, 1x1.\text{if } f : x \mapsto \cos x, \ 0 \leqslant x \leqslant \pi, \qquad\text{then}\qquad f^{-1} : x \mapsto \arccos x, \ -1 \leqslant x \leqslant 1 .

Further, if f:xtanxf : x \mapsto \tan x for π2<x<π2-\dfrac{\pi}{2} < x < \dfrac{\pi}{2}, the inverse function f1f^{-1} exists and is written arctan\arctan or tan1\tan^{-1}, where arctanx\arctan x means “the angle whose tangent is xx”. The domain of xarctanxx \mapsto \arctan x is xRx \in \RR. In the same way arccotx\operatorname{arccot} x is the angle whose cotangent is xx, and for positive xx it is arctan1x\arctan\dfrac{1}{x}.

−11−11xysin and arcsin−11π−11π/2πxycos and arccos−22−22xytan and arctan
Figure 5.19. The restricted sine, cosine and tangent functions and their inverses, reflected in the line y=xy = x.

Remark (A warning about notation).

If the notation sin1\sin^{-1} is adopted, it is most important to appreciate that sin1x\sin^{-1} x is not the same as 1sinx\dfrac{1}{\sin x}.

Common Trigonometric Ratios

The angles 3030^\circ, 4545^\circ and 6060^\circ, and the angles for which these are the associated acute angles, such as 150150^\circ, 225225^\circ and 300300^\circ, are used frequently, so their trigonometric ratios are well worth noting.

Consider first an equilateral triangle ABCABC which is bisected by the line ADAD. In the triangle BADBAD the angle BB is 6060^\circ, or π3\dfrac{\pi}{3}, since the triangle ABCABC is equilateral, and the angle at AA is 3030^\circ, or π6\dfrac{\pi}{6}, since the angle BACBAC is bisected. If AB=2AB = 2 units then BD=1BD = 1 unit, and AD=3AD = \sqrt3 units by Pythagoras. Therefore

sinπ6=sin30=12,sinπ3=sin60=32,cosπ6=cos30=32,cosπ3=cos60=12,tanπ6=tan30=13,tanπ3=tan60=3.\begin{aligned} \sin\frac{\pi}{6} &= \sin 30^\circ = \frac12, & \sin\frac{\pi}{3} &= \sin 60^\circ = \frac{\sqrt3}{2}, \\ \cos\frac{\pi}{6} &= \cos 30^\circ = \frac{\sqrt3}{2}, & \cos\frac{\pi}{3} &= \cos 60^\circ = \frac12, \\ \tan\frac{\pi}{6} &= \tan 30^\circ = \frac{1}{\sqrt3}, & \tan\frac{\pi}{3} &= \tan 60^\circ = \sqrt3 . \end{aligned}

Alternatively we can say

arcsin12=π6,arccos32=π6,arctan13=π6,arcsin32=π3,arccos12=π3,arctan3=π3.\begin{aligned} \arcsin\frac12 &= \frac{\pi}{6}, & \arccos\frac{\sqrt3}{2} &= \frac{\pi}{6}, & \arctan\frac{1}{\sqrt3} &= \frac{\pi}{6}, \\ \arcsin\frac{\sqrt3}{2} &= \frac{\pi}{3}, & \arccos\frac12 &= \frac{\pi}{3}, & \arctan\sqrt3 &= \frac{\pi}{3} . \end{aligned}

Now consider a triangle ABCABC in which AB=BCAB = BC and the angle BB is a right angle, so that the angles at AA and CC are each 4545^\circ. If AB=BC=1AB = BC = 1 unit, then AC=2AC = \sqrt2 units by Pythagoras. Therefore

sinπ4=sin45=12=22,cosπ4=cos45=12=22,tanπ4=tan45=1,\sin\frac{\pi}{4} = \sin 45^\circ = \frac{1}{\sqrt2} = \frac{\sqrt2}{2}, \qquad \cos\frac{\pi}{4} = \cos 45^\circ = \frac{1}{\sqrt2} = \frac{\sqrt2}{2}, \qquad \tan\frac{\pi}{4} = \tan 45^\circ = 1,

and arcsin12=π4=arccos12\arcsin\dfrac{1}{\sqrt2} = \dfrac{\pi}{4} = \arccos\dfrac{1}{\sqrt2}, arctan1=π4\arctan 1 = \dfrac{\pi}{4}.

ABCD21√360°30°half of an equilateral triangleABC11√245°45°a right-angled isosceles triangle
Figure 5.20. The triangles which give the ratios of 3030^\circ, 6060^\circ and 4545^\circ.

Complementary Angles

Definition 5.16 (Complementary Angles).

If the sum of two acute angles is 9090^\circ, or π2\dfrac{\pi}{2}, they are complementary, and each is the complement of the other.

Consider a right-angled triangle ABCABC containing the angles α\alpha and β\beta, as in Figure 5.21. Then

sinα=ac=cosβ,cosα=bc=sinβ,tanα=ab=cotβ,cotα=ba=tanβ.\sin\alpha = \frac{a}{c} = \cos\beta, \qquad \cos\alpha = \frac{b}{c} = \sin\beta, \qquad \tan\alpha = \frac{a}{b} = \cot\beta, \qquad \cot\alpha = \frac{b}{a} = \tan\beta .
ACBαβabc
Figure 5.21. A right-angled triangle containing two complementary angles α\alpha and β\beta.

But α\alpha and β\beta are complementary, so we have shown that the sine of an angle is the cosine of its complement, and the tangent of an angle is the cotangent of its complement. Because of this property the sine and cosine of an angle are called complementary ratios, and similarly the tangent and cotangent are complementary ratios.

The same relationships hold for angles of any size. Reflecting OPOP in the line y=xy = x exchanges the coordinates xx and yy of PP, and turns the angle θ\theta into π2θ\dfrac{\pi}{2} - \theta, so for every angle

sinθ=cos(π2θ),cosθ=sin(π2θ),tanθ=cot(π2θ).\sin\theta = \cos\left(\frac{\pi}{2} - \theta\right), \qquad \cos\theta = \sin\left(\frac{\pi}{2} - \theta\right), \qquad \tan\theta = \cot\left(\frac{\pi}{2} - \theta\right) .

Trigonometric Equations

Definition 5.17 (Trigonometric Equation).

An equation in which at least one term contains a trigonometric ratio is a trigonometric equation. Solving it means finding the angle or angles for which it is true.

Consider the simple equation sinθ=0\sin\theta = 0. Referring to the graph of the sine function, we see that sinθ=0\sin\theta = 0 when θ\theta is any multiple of π\pi, that is when θ=nπ\theta = n\pi, where nZn \in \ZZ. The full, or general, solution of this equation is the infinite set of angles θ=nπ\theta = n\pi, or θ=180n\theta = 180n^\circ.

Sometimes it is necessary to extract certain values of θ\theta from the infinite set. Solving the equation sinθ=0\sin\theta = 0 for πθπ-\pi \leqslant \theta \leqslant \pi, for instance, gives the finite solution set θ=π,0,π\theta = -\pi, 0, \pi.

There are two basic approaches to finding the solution of a trigonometric equation. One of them was used above, and refers to the graph of the appropriate circular function; it is usually best for sines and cosines with the values ±1\pm 1 and 00, and for tangents which are zero or undefined. Alternatively, the position of the rotating line OPOP in the appropriate quadrants can lead to a clear solution. In all cases the first step is to find the principal solution, which is the principal value, PV, of θ\theta.

Principal Values

−11θ−π−π/2π/2πsin θ: principal values in [−π/2, π/2]−11θ−π−π/2π/2πcos θ: principal values in [0, π]−11θ−π−π/2π/2πtan θ: principal values between −π/2 and π/2
Figure 5.22. The intervals in which each value of the sine, cosine and tangent occurs exactly once.
  1. From the graph of the sine function, every possible value of sinθ\sin\theta occurs once and only once in the interval π2θπ2-\dfrac{\pi}{2} \leqslant \theta \leqslant \dfrac{\pi}{2}. So any equation sinθ=s\sin\theta = s, with 1s1-1 \leqslant s \leqslant 1, has one and only one solution in this interval, and this is the principal value of θ\theta, in either the first or the fourth quadrant. For example, if sinθ=12\sin\theta = \frac12 the principal solution is θ=π6\theta = \dfrac{\pi}{6}, and if sinθ=12\sin\theta = -\frac12 it is θ=π6\theta = -\dfrac{\pi}{6}.
  2. Every possible value of cosθ\cos\theta occurs once and only once in the interval 0θπ0 \leqslant \theta \leqslant \pi, so there is one and only one solution of cosθ=c\cos\theta = c in this interval. This is the principal value of θ\theta, in either the first or the second quadrant. If cosθ=12\cos\theta = \frac12 the principal solution is θ=π3\theta = \dfrac{\pi}{3}, and if cosθ=12\cos\theta = -\frac12 it is θ=2π3\theta = \dfrac{2\pi}{3}.
  3. Every possible value of tanθ\tan\theta occurs once and only once for angles in the interval π2<θ<π2-\dfrac{\pi}{2} < \theta < \dfrac{\pi}{2}, so one and only one solution of tanθ=t\tan\theta = t is in this interval, and it is the principal value of θ\theta, in the first or the fourth quadrant. If tanθ=1\tan\theta = 1 the principal solution is θ=π4\theta = \dfrac{\pi}{4}, and if tanθ=1\tan\theta = -1 it is θ=π4\theta = -\dfrac{\pi}{4}.

These intervals are the ranges of the inverse functions, so the principal values of the solutions of sinθ=s\sin\theta = s, cosθ=c\cos\theta = c and tanθ=t\tan\theta = t are arcsins\arcsin s, arccosc\arccos c and arctant\arctan t.

Secondary Values

Having found the principal value of the solution of a trigonometric equation, we usually find a second angle with the same trigonometric ratio in the interval π<θπ-\pi < \theta \leqslant \pi. This solution lies in a different quadrant and is called the secondary value, SV, of θ\theta, or the secondary solution of the equation.

  1. If sinθ=12\sin\theta = \frac12, the secondary solution is in the second quadrant, where the sine ratio is also positive, and it is θ=5π6\theta = \dfrac{5\pi}{6}. If sinθ=12\sin\theta = -\frac12, the secondary solution is in the third quadrant, where the sine ratio is also negative, and it is θ=5π6\theta = -\dfrac{5\pi}{6}.
  2. If cosθ=12\cos\theta = \frac12, the secondary value is in the fourth quadrant and is θ=π3\theta = -\dfrac{\pi}{3}. If cosθ=12\cos\theta = -\frac12, the secondary value is in the third quadrant and is θ=2π3\theta = -\dfrac{2\pi}{3}. For an equation of the form cosθ=c\cos\theta = c, SV=PV\text{SV} = -\text{PV}.
  3. If tanθ=1\tan\theta = 1, the secondary solution is in the third quadrant and is θ=3π4\theta = -\dfrac{3\pi}{4}. If tanθ=1\tan\theta = -1, the secondary value is in the second quadrant and is θ=3π4\theta = \dfrac{3\pi}{4}.
PV π/6SV 5π/6sin θ = ½PV π/3SV −π/3cos θ = ½PV π/4SV −3π/4tan θ = 1PV −π/6SV −5π/6sin θ = −½PV 2π/3SV −2π/3cos θ = −½PV −π/4SV 3π/4tan θ = −1
Figure 5.23. Principal and secondary values for six equations.

Problem 5.6.

  1. Determine the principal solutions of sinθ=32\sin\theta = -\dfrac{\sqrt3}{2}, cosθ=12\cos\theta = -\dfrac{1}{\sqrt2} and tanθ=33\tan\theta = -\dfrac{\sqrt3}{3}.
  2. Find the principal and secondary solutions of sinθ=12\sin\theta = \dfrac{1}{\sqrt2}, cosθ=32\cos\theta = -\dfrac{\sqrt3}{2} and tanθ=3\tan\theta = -\sqrt3.
  3. By referring to the graphs of the appropriate circular functions, explain why the equations sinθ=1\sin\theta = -1 and cosθ=1\cos\theta = 1 have no secondary solution.

Solutions in a Specified Range

In solving a trigonometric equation in a specified range we first find the principal angle and the secondary angle, except in those cases where there is no secondary angle. A quadrant diagram can then be drawn showing the two solution positions, and any angle measured from the positive xx-axis to either of the solution positions is a solution of the equation.

Example 5.18.

Solve the equation sinθ=0.4\sin\theta = 0.4 within the interval 360θ360-360^\circ \leqslant \theta \leqslant 360^\circ.

The principal solution is θ=23.58\theta = 23.58^\circ. The secondary solution is in the second quadrant, since the sine ratio is positive in the first and second quadrants, and it is θ=156.42\theta = 156.42^\circ. Therefore the solutions within the specified interval are

θ=336.42,203.58,23.58,156.42.\theta = -336.42^\circ, \quad -203.58^\circ, \quad 23.58^\circ, \quad 156.42^\circ .
−360°−270°−180°−90°90°180°270°360°θ−110.4
Figure 5.24. The four solutions of sinθ=0.4\sin\theta = 0.4 between 360-360^\circ and 360360^\circ.

Example 5.19.

Solve the equation tanθ=13\tan\theta = -\dfrac{1}{\sqrt3} in the interval 0θ2π0 \leqslant \theta \leqslant 2\pi.

If tanθ=13\tan\theta = -\dfrac{1}{\sqrt3}, the principal solution is in the fourth quadrant and the secondary solution is in the second quadrant: the PV is π6-\dfrac{\pi}{6} and the SV is 5π6\dfrac{5\pi}{6}. Within the specified interval the solution set is

θ=5π6,11π6.\theta = \frac{5\pi}{6}, \quad \frac{11\pi}{6} .

As here, the principal value is not always included in the solution set.

Example 5.20.

Find the angles in the interval 360θ0-360^\circ \leqslant \theta \leqslant 0 which satisfy the equation cosθ=0.7\cos\theta = 0.7.

Since cosθ\cos\theta is positive, the principal solution is in the first quadrant and the secondary solution is in the fourth: the PV is 45.5745.57^\circ and the SV is 45.57-45.57^\circ. In the interval 360θ0-360^\circ \leqslant \theta \leqslant 0 the solution set is θ=314.43,45.57\theta = -314.43^\circ, -45.57^\circ.

Example 5.21.

Solve, within the interval 0θ3600 \leqslant \theta \leqslant 360^\circ, the equation sinθ+3sinθcosθ=0\sin\theta + 3\sin\theta\cos\theta = 0.

First the equation must be factorised:

sinθ(1+3cosθ)=0.\sin\theta\,(1 + 3\cos\theta) = 0 .

Therefore either sinθ=0\sin\theta = 0 or cosθ=13\cos\theta = -\frac13.

  1. Referring to the sine graph, sinθ=0\sin\theta = 0 gives θ=0,180,360\theta = 0, 180^\circ, 360^\circ.
  2. For cosθ=13\cos\theta = -\frac13 the principal solution is in the second quadrant and the secondary solution in the third: the PV is 109.47109.47^\circ and the SV is 109.47-109.47^\circ. Within the specified range these give θ=109.47,250.53\theta = 109.47^\circ, 250.53^\circ.

So the complete solution set from 00 to 360360^\circ is θ=0,109.47,180,250.53,360\theta = 0, 109.47^\circ, 180^\circ, 250.53^\circ, 360^\circ.

Although the solutions of sinθ=0\sin\theta = 0 could conveniently be expressed in radians, degrees are used because the range is specified in degrees. Units must not be mixed in any one example.

Problem 5.7.

Solve the following equations for angles in the interval 0θ2π0 \leqslant \theta \leqslant 2\pi.

  1. 3tanθ=2sinθ\sqrt3\tan\theta = 2\sin\theta;
  2. 2sinθcosθ+sinθ=02\sin\theta\cos\theta + \sin\theta = 0;
  3. 4cosθ=cosθcosecθ4\cos\theta = \cos\theta\operatorname{cosec}\theta.

General Solutions

Definition 5.22 (General Solution).

The general solution of a trigonometric equation is an expression which represents all the angles which satisfy the equation, that is an infinite set of angles.

In looking for a general solution we use the graphs of the circular functions, the period of each circular function, and the principal solution together with, except when the tangent ratio is involved, the secondary solution.

Consider the equation sinθ=s\sin\theta = s, where 1s1-1 \leqslant s \leqslant 1. The period 2π2\pi of the sine function is covered by the interval π<θπ-\pi < \theta \leqslant \pi, which includes both the PV and the SV of θ\theta. So by adding or subtracting any multiple of 2π2\pi to either the PV or the SV we get another angle with the same sine. Thus the complete solution of sinθ=s\sin\theta = s is

θ=PV+2nπorθ=SV+2nπ,nZ,\theta = \text{PV} + 2n\pi \quad\text{or}\quad \theta = \text{SV} + 2n\pi, \qquad n \in \ZZ,

or, in degrees, θ=PV+360n\theta = \text{PV} + 360n^\circ or θ=SV+360n\theta = \text{SV} + 360n^\circ.

A similar situation arises for the equation cosθ=c\cos\theta = c, because both the PV and the SV of the cosine lie within one period, which is again 2π2\pi. So the complete solution of cosθ=c\cos\theta = c is also given by adding multiples of 2π2\pi to either the PV or the SV. Remembering that for cosines the PV and the SV are equal in value but opposite in sign, the general solution of cosθ=c\cos\theta = c can be given in the form

θ=±PV+2nπorθ=±PV+360n,nZ.\theta = \pm\text{PV} + 2n\pi \quad\text{or}\quad \theta = \pm\text{PV} + 360n^\circ, \qquad n \in \ZZ .

For the equation tanθ=t\tan\theta = t, only the principal value is included in the complete period π2<θ<π2-\dfrac{\pi}{2} < \theta < \dfrac{\pi}{2}. All further angles with the same tangent are given by adding multiples of π\pi, the period, to the PV:

θ=PV+nπ,nZ.\theta = \text{PV} + n\pi, \qquad n \in \ZZ .

Example 5.23.

Find the general solution of each of the equations tanθ=1\tan\theta = 1 and tanθ=3\tan\theta = -\sqrt3.

The principal solution of tanθ=1\tan\theta = 1 is θ=π4\theta = \dfrac{\pi}{4}, so the general solution is θ=π4+nπ\theta = \dfrac{\pi}{4} + n\pi, where nZn \in \ZZ.

If tanθ=3\tan\theta = -\sqrt3, the principal solution is θ=π3\theta = -\dfrac{\pi}{3}, and the general solution is therefore θ=nππ3\theta = n\pi - \dfrac{\pi}{3}.

Example 5.24.

Find the general solution of each of the equations cosθ=12\cos\theta = \dfrac{1}{\sqrt2} and cosθ=12\cos\theta = -\dfrac12.

The principal solution of cosθ=12\cos\theta = \dfrac{1}{\sqrt2} is θ=π4\theta = \dfrac{\pi}{4}, so the general solution is θ=2nπ±π4\theta = 2n\pi \pm \dfrac{\pi}{4}.

When cosθ=12\cos\theta = -\frac12, the principal value of θ\theta is 2π3\dfrac{2\pi}{3}, and the general solution is θ=2nπ±2π3\theta = 2n\pi \pm \dfrac{2\pi}{3}.

Example 5.25.

Find the general solution set of the equation sinθ=12\sin\theta = \frac12.

The principal value of θ\theta for which sinθ=12\sin\theta = \frac12 is π6\dfrac{\pi}{6}, and the secondary value, in the second quadrant, is 5π6\dfrac{5\pi}{6}. So the general solution set includes

θ=π6+2nπandθ=5π6+2nπ.\theta = \frac{\pi}{6} + 2n\pi \qquad\text{and}\qquad \theta = \frac{5\pi}{6} + 2n\pi .

Remark.

There is a way of combining the two parts of the general solution of sinθ=s\sin\theta = s into one formula,

θ=(1)nPV+nπ,nZ.\theta = (-1)^n\,\text{PV} + n\pi, \qquad n \in \ZZ .

When nn is even this is PV+2kπ\text{PV} + 2k\pi, and when nn is odd it is πPV+2kπ\pi - \text{PV} + 2k\pi, which is the secondary value plus a multiple of 2π2\pi. So when sinθ=12\sin\theta = \frac12, θ=(1)nπ6+nπ\theta = (-1)^n\dfrac{\pi}{6} + n\pi. Either form of the general solution may be used.

Example 5.26.

Find the general solution of the equation 4sinθ(2tanθ+3)+6tanθ+9=04\sin\theta\,(2\tan\theta + 3) + 6\tan\theta + 9 = 0.

First we simplify and factorise the equation:

4sinθ(2tanθ+3)+3(2tanθ+3)=0,(4sinθ+3)(2tanθ+3)=0.4\sin\theta\,(2\tan\theta + 3) + 3(2\tan\theta + 3) = 0, \qquad (4\sin\theta + 3)(2\tan\theta + 3) = 0 .

So either sinθ=34\sin\theta = -\frac34 or tanθ=32\tan\theta = -\frac32.

  1. For sinθ=34\sin\theta = -\frac34 the principal solution is θ=48.59\theta = -48.59^\circ, and the secondary solution, in the third quadrant, is θ=131.41\theta = -131.41^\circ. Hence the general solution is θ=48.59+360n\theta = -48.59^\circ + 360n^\circ or θ=131.41+360n\theta = -131.41^\circ + 360n^\circ.
  2. For tanθ=32\tan\theta = -\frac32 the principal solution is the only one we need, and it is θ=56.31\theta = -56.31^\circ. The general solution is then θ=56.31+180n\theta = -56.31^\circ + 180n^\circ.

Combining these results, the general solution set of the given equation is

θ=48.59+360n,θ=131.41+360n,θ=56.31+180n.\theta = -48.59^\circ + 360n^\circ, \qquad \theta = -131.41^\circ + 360n^\circ, \qquad \theta = -56.31^\circ + 180n^\circ .

Problem 5.8.

Find the general solution of each of the following equations.

  1. sinθ=32\sin\theta = -\dfrac{\sqrt3}{2};
  2. cosθ=0\cos\theta = 0;
  3. cosθ=0.371\cos\theta = 0.371.

Multiple Angles

Equations are frequently met in which the angle involved is a multiple of θ\theta, such as cos2θ=12\cos 2\theta = \frac12 or tan3θ=2\tan 3\theta = -2. Such equations are solved by determining first the necessary values of the multiple angle and then, by division, the corresponding values of θ\theta.

Example 5.27.

Find the general solution of the equation cos2θ=12\cos 2\theta = \frac12.

Let 2θ=φ2\theta = \varphi, so that cosφ=12\cos\varphi = \frac12. The principal value of φ\varphi is π3\dfrac{\pi}{3}, so the general solution for φ\varphi is φ=±π3+2nπ\varphi = \pm\dfrac{\pi}{3} + 2n\pi, that is

2θ=±π3+2nπ,henceθ=±π6+nπ.2\theta = \pm\frac{\pi}{3} + 2n\pi, \qquad\text{hence}\qquad \theta = \pm\frac{\pi}{6} + n\pi .

Example 5.28.

Find the angles within the range 180θ180-180^\circ \leqslant \theta \leqslant 180^\circ which satisfy the equation tan3θ=2\tan 3\theta = -2.

Let 3θ=φ3\theta = \varphi, so that tanφ=2\tan\varphi = -2. The principal value is in the fourth quadrant, φ=63.43\varphi = -63.43^\circ, and the secondary value is in the second quadrant, φ=116.57\varphi = 116.57^\circ. Values of θ\theta are required in the range 180θ180-180^\circ \leqslant \theta \leqslant 180^\circ, and φ=3θ\varphi = 3\theta, so we need the values of φ\varphi in the range 540φ540-540^\circ \leqslant \varphi \leqslant 540^\circ. These are

φ=423.43,243.43,63.43,116.57,296.57,476.57,\varphi = -423.43^\circ, \quad -243.43^\circ, \quad -63.43^\circ, \quad 116.57^\circ, \quad 296.57^\circ, \quad 476.57^\circ,

and therefore

θ=141.14,81.14,21.14,38.86,98.86,158.86.\theta = -141.14^\circ, \quad -81.14^\circ, \quad -21.14^\circ, \quad 38.86^\circ, \quad 98.86^\circ, \quad 158.86^\circ .

Alternatively, quoting the general solution for φ\varphi gives φ=63.43+180n\varphi = -63.43^\circ + 180n^\circ, so that θ=21.14+60n\theta = -21.14^\circ + 60n^\circ. Giving nn the values 2,1,0,1,2,3-2, -1, 0, 1, 2, 3, which cover the required range, gives the same values of θ\theta.

Example 5.29.

Find the solutions of the equation sinθ2=0.6\sin\dfrac{\theta}{2} = 0.6 for values of θ\theta between 00 and 360360^\circ.

Let θ2=φ\dfrac{\theta}{2} = \varphi, so that sinφ=0.6\sin\varphi = 0.6. The principal value of φ\varphi is 36.8736.87^\circ, and the secondary value, in the second quadrant, is 143.13143.13^\circ. The required range of values of θ\theta is from 00 to 360360^\circ, so the range of values of φ\varphi is from 00 to 180180^\circ, which gives φ=36.87,143.13\varphi = 36.87^\circ, 143.13^\circ. Therefore θ=73.74,286.26\theta = 73.74^\circ, 286.26^\circ.

Problem 5.9.

  1. Solve the equations tan2θ=1\tan 2\theta = 1 and sin3θ=0.7\sin 3\theta = 0.7 within the interval 0θ3600 \leqslant \theta \leqslant 360^\circ.
  2. Find the general solution of the equation cos2θ=0.63\cos 2\theta = 0.63.

The Equation cosA=cosB\cos A = \cos B

This type of equation can be solved very neatly as follows. Let cosA=cosB=c\cos A = \cos B = c, where 1c1-1 \leqslant c \leqslant 1. In general there are two solution positions for cosB=c\cos B = c, OP1OP_1 and OP2OP_2, and the set of angles represented by OP1OP_1 and OP2OP_2 is 2nπ±B2n\pi \pm B. But we also know that cosA=c\cos A = c, so OP1OP_1 and OP2OP_2 together represent all possible values of AA. Thus

cosA=cosBgivesA=2nπ±B,\cos A = \cos B \qquad\text{gives}\qquad A = 2n\pi \pm B,

that is, the values of AA are the general solution set for BB. The same argument for tangents and sines gives

tanA=tanB  gives  A=nπ+B,sinA=sinB  gives  A=2nπ+B  or  A=(2n+1)πB.\tan A = \tan B \ \text{ gives } \ A = n\pi + B, \qquad \sin A = \sin B \ \text{ gives } \ A = 2n\pi + B \ \text{ or } \ A = (2n + 1)\pi - B .

Example 5.30.

Solve the equation cos4θ=cosθ\cos 4\theta = \cos\theta.

Using the conclusion above,

4θ=2nπ±θ,so5θ=2nπor3θ=2nπ,4\theta = 2n\pi \pm \theta, \qquad\text{so}\qquad 5\theta = 2n\pi \quad\text{or}\quad 3\theta = 2n\pi,

and hence θ=2nπ5\theta = \dfrac{2n\pi}{5} or θ=2nπ3\theta = \dfrac{2n\pi}{3}.

Example 5.31.

Find the values in the range 0θ3600 \leqslant \theta \leqslant 360^\circ which satisfy the equation tan(3θ40)=tanθ\tan(3\theta - 40^\circ) = \tan\theta.

The general solution is

3θ40=180n+θ,2θ=180n+40,θ=90n+20.3\theta - 40^\circ = 180n^\circ + \theta, \qquad 2\theta = 180n^\circ + 40^\circ, \qquad \theta = 90n^\circ + 20^\circ .

For 0θ3600 \leqslant \theta \leqslant 360^\circ we let n=0,1,2,3n = 0, 1, 2, 3, giving θ=20,110,200,290\theta = 20^\circ, 110^\circ, 200^\circ, 290^\circ.

This method can be used only for equations containing two terms involving the same trigonometric ratio. That situation can sometimes be arranged in an apparently unsuitable case, as in the next example.

Example 5.32.

Find the general solution of cos3θ=sinθ\cos 3\theta = \sin\theta.

We know that sinθ=cos(π2θ)\sin\theta = \cos\left(\dfrac{\pi}{2} - \theta\right), from complementary angles, so the equation can be written

cos3θ=cos(π2θ),so3θ=2nπ±(π2θ).\cos 3\theta = \cos\left(\frac{\pi}{2} - \theta\right), \qquad\text{so}\qquad 3\theta = 2n\pi \pm \left(\frac{\pi}{2} - \theta\right) .

Therefore either 4θ=2nπ+π24\theta = 2n\pi + \dfrac{\pi}{2} or 2θ=2nππ22\theta = 2n\pi - \dfrac{\pi}{2}, that is

θ=nπ2+π8orθ=nππ4.\theta = \frac{n\pi}{2} + \frac{\pi}{8} \qquad\text{or}\qquad \theta = n\pi - \frac{\pi}{4} .

Problem 5.10.

  1. Find the general solutions of the equations cos4θ=cos3θ\cos 4\theta = \cos 3\theta and sin4θ=sin3θ\sin 4\theta = \sin 3\theta.
  2. Solve the equation cos(2θ+60)=cosθ\cos(2\theta + 60^\circ) = \cos\theta, giving the values of θ\theta from 180-180^\circ to 180180^\circ.

Graphs of Multiple and Compound Angles

Consider f:θsin2θf : \theta \mapsto \sin 2\theta. The following table gives pairs of corresponding values of θ\theta and f(θ)f(\theta).

θ\theta00π4\frac{\pi}{4}π2\frac{\pi}{2}3π4\frac{3\pi}{4}π\pi5π4\frac{5\pi}{4}3π2\frac{3\pi}{2}7π4\frac{7\pi}{4}2π2\pi
2θ2\theta00π2\frac{\pi}{2}π\pi3π2\frac{3\pi}{2}2π2\pi5π2\frac{5\pi}{2}3π3\pi7π2\frac{7\pi}{2}4π4\pi
f(θ)f(\theta)0011001-10011001-100
−11θπ/4π/23π/4π5π/43π/27π/4
Figure 5.25. The graph of f(θ)=sin2θf(\theta) = \sin 2\theta, with the graph of sinθ\sin\theta dashed.

The following characteristics can be observed.

  1. The function sin2θ\sin 2\theta is cyclic, and its period is π\pi, that is 12×2π\frac12 \times 2\pi.
  2. Its range is 1sin2θ1-1 \leqslant \sin 2\theta \leqslant 1.
  3. Its shape is a sine wave.
  4. Within the domain 0θ2π0 \leqslant \theta \leqslant 2\pi there are two complete cycles of the curve, compared with only one for the basic function θsinθ\theta \mapsto \sin\theta: the complete cycle appears with twice the frequency.

When the same investigation is carried out on θsin3θ\theta \mapsto \sin 3\theta, we find that the function is cyclic with period 2π3\dfrac{2\pi}{3}, so that three complete cycles occur between 00 and 2π2\pi. In general the graph of θsinkθ\theta \mapsto \sin k\theta, for k>0k > 0, is a sine wave with period 2πk\dfrac{2\pi}{k} and a frequency kk times that of θsinθ\theta \mapsto \sin\theta. We show this by noting that

sink(θ+2πk)=sin(kθ+2π)=sinkθ,\sin k\left(\theta + \frac{2\pi}{k}\right) = \sin(k\theta + 2\pi) = \sin k\theta,

so that the graph repeats after a width of 2πk\dfrac{2\pi}{k}, while as θ\theta runs through any interval of that width, kθk\theta runs through an interval of width 2π2\pi and so through one complete sine wave. Similar properties hold for θcoskθ\theta \mapsto \cos k\theta, whose period is 2πk\dfrac{2\pi}{k}, and for θtankθ\theta \mapsto \tan k\theta, whose period is πk\dfrac{\pi}{k}. For example, the period of tan2θ\tan 2\theta is π2\dfrac{\pi}{2} and its frequency is 22; the period of cos4θ\cos 4\theta is π2\dfrac{\pi}{2} and its frequency is 44; the period of sinθ2\sin\dfrac{\theta}{2} is 4π4\pi and its frequency is 12\frac12.

−22θπ/4π/23π/4π5π/43π/27π/4tan 2θ, with tan θ dashed−11θπ/4π/23π/4π5π/43π/27π/4cos 4θ, with cos θ dashed−11θπ/2π3π/25π/27π/2sin ½θ, with sin θ dashed
Figure 5.26. The graphs of tan2θ\tan 2\theta, cos4θ\cos 4\theta and sin12θ\sin\frac12\theta.

Now consider the function f(θ)=cos(θα)f(\theta) = \cos(\theta - \alpha). This is clearly a cosine function, but

  1. f(θ)=0f(\theta) = 0 when θα=π2,3π2,\theta - \alpha = \dfrac{\pi}{2}, \dfrac{3\pi}{2}, \ldots, that is when θ=π2+α,3π2+α,\theta = \dfrac{\pi}{2} + \alpha, \dfrac{3\pi}{2} + \alpha, \ldots;
  2. f(θ)=1f(\theta) = 1 when θα=0,2π,4π,\theta - \alpha = 0, 2\pi, 4\pi, \ldots, that is when θ=α,2π+α,4π+α,\theta = \alpha, 2\pi + \alpha, 4\pi + \alpha, \ldots;
  3. f(θ)=1f(\theta) = -1 when θα=π,3π,5π,\theta - \alpha = \pi, 3\pi, 5\pi, \ldots, that is when θ=π+α,3π+α,5π+α,\theta = \pi + \alpha, 3\pi + \alpha, 5\pi + \alpha, \ldots.

So the graph of f(θ)=cos(θπ4)f(\theta) = \cos\left(\theta - \dfrac{\pi}{4}\right), for example, is identical in shape to the graph of f(θ)=cosθf(\theta) = \cos\theta, but is in a position given by moving the standard cosine curve a horizontal distance π4\dfrac{\pi}{4} to the right. Similarly the graph of f(θ)=cos(θ+α)f(\theta) = \cos(\theta + \alpha) is given by moving the standard cosine curve a horizontal distance α\alpha to the left, as the graph of cos(θ+π3)\cos\left(\theta + \dfrac{\pi}{3}\right) shows.

−11θ−π−3π/4−π/2−π/4π/4π/23π/4π5π/43π/27π/4cos(θ − π/4), with cos θ dashed−11θ−π−2π/3−π/3π/32π/3π4π/35π/3cos(θ + π/3), with cos θ dashed
Figure 5.27. The graphs of cos(θπ4)\cos\left(\theta - \frac{\pi}{4}\right) and cos(θ+π3)\cos\left(\theta + \frac{\pi}{3}\right).

Now consider the function f(θ)=sin(2θ+α)f(\theta) = \sin(2\theta + \alpha). Adding a constant angle moves a curve to the left, and in this case sin(2θ+α)=0\sin(2\theta + \alpha) = 0 when θ=α2\theta = -\dfrac{\alpha}{2}, so the graph of this function is obtained by moving the graph of sin2θ\sin 2\theta a distance α2\dfrac{\alpha}{2} to the left. For example, the graph of sin(2θ+π2)\sin\left(2\theta + \dfrac{\pi}{2}\right) is that of sin2θ\sin 2\theta moved π4\dfrac{\pi}{4} to the left.

Similarly, if f(θ)=cos(3θπ4)f(\theta) = \cos\left(3\theta - \dfrac{\pi}{4}\right), putting 3θπ4=03\theta - \dfrac{\pi}{4} = 0 shows that the graph is obtained by moving the graph of cos3θ\cos 3\theta a distance π12\dfrac{\pi}{12} to the right. And if f(θ)=tan(θ2+π4)f(\theta) = \tan\left(\dfrac{\theta}{2} + \dfrac{\pi}{4}\right), we have a tangent curve with a frequency of 12\frac12 which is moved a distance π2\dfrac{\pi}{2} to the left.

−11θ−π/2−π/4π/4π/23π/4π5π/43π/27π/4sin(2θ + π/2), with sin 2θ dashed−11θπ/6π/3π/22π/35π/6π7π/64π/33π/25π/311π/6cos(3θ − π/4), with cos 3θ dashed−22θ−2π−3π/2−π−π/2π/2π3π/2tan(½θ + π/4), with tan ½θ dashed
Figure 5.28. The graphs of sin(2θ+π2)\sin\left(2\theta + \frac{\pi}{2}\right), cos(3θπ4)\cos\left(3\theta - \frac{\pi}{4}\right) and tan(12θ+π4)\tan\left(\frac12\theta + \frac{\pi}{4}\right).

An equation containing a compound angle is solved in the same way as one containing a multiple angle.

Example 5.33.

Find the general solution of the equation cos(2θπ6)=12\cos\left(2\theta - \dfrac{\pi}{6}\right) = \dfrac12.

The principal value of 2θπ62\theta - \dfrac{\pi}{6} is π3\dfrac{\pi}{3}, so

2θπ6=±π3+2nπ,2θ=±π3+2nπ+π6,θ=±π6+nπ+π12,2\theta - \frac{\pi}{6} = \pm\frac{\pi}{3} + 2n\pi, \qquad 2\theta = \pm\frac{\pi}{3} + 2n\pi + \frac{\pi}{6}, \qquad \theta = \pm\frac{\pi}{6} + n\pi + \frac{\pi}{12},

that is θ=nπ+π4\theta = n\pi + \dfrac{\pi}{4} or θ=nππ12\theta = n\pi - \dfrac{\pi}{12}.

Problem 5.11.

  1. Sketch the graphs of sin4θ\sin 4\theta and sec2θ\sec 2\theta in the domain 0θ2π0 \leqslant \theta \leqslant 2\pi, and state the period and the frequency of each function.
  2. Find the general solution of the equation cos(θπ6)=12\cos\left(\theta - \dfrac{\pi}{6}\right) = -\dfrac12.

Trigonometric Identities

Any one angle has six trigonometric ratios, and a particular value of one ratio applies to an infinite set of angles, so it is not surprising that relationships exist between the various circular functions. They are identities, true for every angle for which the ratios are defined, and they are very useful in the development of trigonometry.

Consider first the relationship between the sine, cosine and tangent of any angle. With P(x,y)P(x, y) as in Figure 5.29,

sinθ=yOP,cosθ=xOP,tanθ=yx.\sin\theta = \frac{y}{OP}, \qquad \cos\theta = \frac{x}{OP}, \qquad \tan\theta = \frac{y}{x} .

But yx=yOP÷xOP\dfrac{y}{x} = \dfrac{y}{OP} \div \dfrac{x}{OP}, so for all angles

tanθ=sinθcosθ,and similarlycotθ=cosθsinθ.\tan\theta = \frac{\sin\theta}{\cos\theta}, \qquad\text{and similarly}\qquad \cot\theta = \frac{\cos\theta}{\sin\theta} .
xyP(x, y)QOxyOPθ
Figure 5.29. The right-angled triangle OPQOPQ for any position of PP.

The Pythagorean Identities

For any position of OPOP a right-angled triangle OPQOPQ can be drawn, for which, by Pythagoras,

x2+y2=OP2.x^2 + y^2 = OP^2 .

Dividing throughout, in turn, by OP2OP^2, x2x^2 and y2y^2 gives

(xOP)2+(yOP)2=1,1+(yx)2=(OPx)2,(xy)2+1=(OPy)2.\left(\frac{x}{OP}\right)^2 + \left(\frac{y}{OP}\right)^2 = 1, \qquad 1 + \left(\frac{y}{x}\right)^2 = \left(\frac{OP}{x}\right)^2, \qquad \left(\frac{x}{y}\right)^2 + 1 = \left(\frac{OP}{y}\right)^2 .

The use of brackets when raising a trigonometric ratio to a power can be avoided by writing cos2θ\cos^2\theta for (cosθ)2(\cos\theta)^2, and so on, and then these become

cos2θ+sin2θ=1,1+tan2θ=sec2θ,cot2θ+1=cosec2θ.\cos^2\theta + \sin^2\theta = 1, \qquad 1 + \tan^2\theta = \sec^2\theta, \qquad \cot^2\theta + 1 = \operatorname{cosec}^2\theta .

These relationships are valid for any position of OPOP, that is for all angles. They are very useful in the solution of certain trigonometric equations.

Example 5.34.

Solve the equation 2cos2θsinθ=12\cos^2\theta - \sin\theta = 1 for values of θ\theta between 00 and 2π2\pi.

Using cos2θ+sin2θ=1\cos^2\theta + \sin^2\theta = 1 gives

2(1sin2θ)sinθ=1,or2sin2θ+sinθ1=0.2(1 - \sin^2\theta) - \sin\theta = 1, \qquad\text{or}\qquad 2\sin^2\theta + \sin\theta - 1 = 0 .

This is now a quadratic equation in sinθ\sin\theta, of the form 2x2+x1=02x^2 + x - 1 = 0, hence

(2sinθ1)(sinθ+1)=0,sinθ=12 or sinθ=1.(2\sin\theta - 1)(\sin\theta + 1) = 0, \qquad \sin\theta = \tfrac12 \ \text{or}\ \sin\theta = -1 .

If sinθ=12\sin\theta = \frac12, θ=π6,5π6\theta = \dfrac{\pi}{6}, \dfrac{5\pi}{6}, and if sinθ=1\sin\theta = -1, θ=3π2\theta = \dfrac{3\pi}{2}. Therefore the solution of the equation is θ=π6,5π6,3π2\theta = \dfrac{\pi}{6}, \dfrac{5\pi}{6}, \dfrac{3\pi}{2}.

Example 5.35.

If 3sec2θ5tanθ4=03\sec^2\theta - 5\tan\theta - 4 = 0, find the general solution.

Using 1+tan2θ=sec2θ1 + \tan^2\theta = \sec^2\theta we have

3(1+tan2θ)5tanθ4=0,that is3tan2θ5tanθ1=0.3(1 + \tan^2\theta) - 5\tan\theta - 4 = 0, \qquad\text{that is}\qquad 3\tan^2\theta - 5\tan\theta - 1 = 0 .

Again we have a quadratic equation, but because it has no simple factors we solve it by the formula:

tanθ=5±25+126=1.8471 or 0.1805.\tan\theta = \frac{5 \pm \sqrt{25 + 12}}{6} = 1.8471 \ \text{or}\ -0.1805 .

If tanθ=1.8471\tan\theta = 1.8471 the principal solution is θ=61.57\theta = 61.57^\circ, and if tanθ=0.1805\tan\theta = -0.1805 it is θ=10.23\theta = -10.23^\circ. The complete general solution is therefore

θ=180n+61.57orθ=180n10.23.\theta = 180n^\circ + 61.57^\circ \qquad\text{or}\qquad \theta = 180n^\circ - 10.23^\circ .

Other applications of the standard identities include the derivation of further trigonometric relationships, the elimination of trigonometric terms from pairs of equations, and the calculation of the remaining trigonometric ratios of an angle for which only one ratio is known.

Example 5.36.

Show that (1cosA)(1+secA)=sinAtanA(1 - \cos A)(1 + \sec A) = \sin A\tan A.

Because this relationship has yet to be established, we must not assume that it is true by using the complete identity in our working: the left- and right-hand sides must be kept apart throughout. Considering the left-hand side,

(1cosA)(1+secA)=1+secAcosAcosAsecA=1+secAcosA1=1cosAcosA=1cos2AcosA=sin2AcosA=sinAtanA,\begin{aligned} (1 - \cos A)(1 + \sec A) &= 1 + \sec A - \cos A - \cos A\sec A = 1 + \sec A - \cos A - 1 \\ &= \frac{1}{\cos A} - \cos A = \frac{1 - \cos^2 A}{\cos A} = \frac{\sin^2 A}{\cos A} = \sin A\tan A, \end{aligned}

which is identical to the right-hand side.

Example 5.37.

Show that (cosecAsinA)(secAcosA)=1tanA+cotA(\operatorname{cosec} A - \sin A)(\sec A - \cos A) = \dfrac{1}{\tan A + \cot A}.

Considering the left-hand side,

(cosecAsinA)(secAcosA)=(1sin2AsinA)(1cos2AcosA)=cos2AsinAsin2AcosA=cosAsinA.(\operatorname{cosec} A - \sin A)(\sec A - \cos A) = \left(\frac{1 - \sin^2 A}{\sin A}\right)\left(\frac{1 - \cos^2 A}{\cos A}\right) = \frac{\cos^2 A}{\sin A} \cdot \frac{\sin^2 A}{\cos A} = \cos A\sin A .

This is already a very simple form, but it is not obviously identical to the right-hand side, so this time we work independently on the right-hand side:

1tanA+cotA=1÷(sinAcosA+cosAsinA)=1÷sin2A+cos2AcosAsinA=cosAsinA.\frac{1}{\tan A + \cot A} = 1 \div \left(\frac{\sin A}{\cos A} + \frac{\cos A}{\sin A}\right) = 1 \div \frac{\sin^2 A + \cos^2 A}{\cos A\sin A} = \cos A\sin A .

Since both sides reduce to cosAsinA\cos A\sin A, they are identical.

Example 5.38.

Eliminate θ\theta from the equations x=2cosθx = 2\cos\theta and y=3sinθy = 3\sin\theta.

Here cosθ=x2\cos\theta = \dfrac{x}{2} and sinθ=y3\sin\theta = \dfrac{y}{3}. Using cos2θ+sin2θ=1\cos^2\theta + \sin^2\theta = 1 gives

x24+y29=1,that is9x2+4y2=36.\frac{x^2}{4} + \frac{y^2}{9} = 1, \qquad\text{that is}\qquad 9x^2 + 4y^2 = 36 .

In this problem both xx and yy depend on θ\theta, a variable angle. Used in this way, θ\theta is called a parameter.

Example 5.39.

If sinA=13\sin A = \frac13 and AA is obtuse, find cosA\cos A and cotA\cot A without using a calculator.

Using cos2A+sin2A=1\cos^2 A + \sin^2 A = 1 gives cos2A+19=1\cos^2 A + \frac19 = 1, so cos2A=89\cos^2 A = \frac89 and cosA=±223\cos A = \pm\dfrac{2\sqrt2}{3}. But AA is obtuse, so cosA\cos A is negative. Hence

cosA=223,cotA=cosAsinA=22.\cos A = -\frac{2\sqrt2}{3}, \qquad \cot A = \frac{\cos A}{\sin A} = -2\sqrt2 .

This type of problem can often be done more directly by drawing the appropriate right-angled triangle and using Pythagoras.

Problem 5.12.

  1. Solve the equation tanθ+cotθ=2\tan\theta + \cot\theta = 2 for angles in the range 180θ180-180^\circ \leqslant \theta \leqslant 180^\circ.
  2. Find the general solution of the equation 5cosθ4sin2θ=25\cos\theta - 4\sin^2\theta = 2.
  3. Show that cotθ+tanθ=secθcosecθ\cot\theta + \tan\theta = \sec\theta\operatorname{cosec}\theta, and that sinA1+cosA=1cosAsinA\dfrac{\sin A}{1 + \cos A} = \dfrac{1 - \cos A}{\sin A}.
  4. Eliminate θ\theta from the equations x=4secθx = 4\sec\theta and y=5tanθy = 5\tan\theta.

Compound Angle Identities

It is often useful to be able to express the trigonometric ratios of angles such as A+BA + B or ABA - B in terms of the ratios of AA and of BB. At first sight it is dangerously easy to think, for instance, that sin(A+B)\sin(A + B) is sinA+sinB\sin A + \sin B. That this is false can be seen by considering

sin(45+45)=sin90=1,whereassin45+sin45=22+22=21.\sin(45^\circ + 45^\circ) = \sin 90^\circ = 1, \qquad\text{whereas}\qquad \sin 45^\circ + \sin 45^\circ = \frac{\sqrt2}{2} + \frac{\sqrt2}{2} = \sqrt2 \neq 1 .

So the sine function is not distributive, and similarly for the other trigonometric ratios. The correct expression is

sin(A+B)=sinAcosB+cosAsinB.\sin(A + B) = \sin A\cos B + \cos A\sin B .

We show this geometrically when AA and BB are both acute, using Figure 5.30. The right-angled triangles OPQOPQ and OQROQR contain the angles AA and BB, RTRT is perpendicular to OPOP, and QSQS is perpendicular to RTRT. Since QSQS is parallel to OPOP, the angle SQOSQO is AA, so the angle SQRSQR is 90A90^\circ - A and the angle SRQSRQ is equal to AA. Since TS=PQTS = PQ,

sin(A+B)=TROR=TS+SROR=PQOR+SROR=PQOQOQOR+SRQRQROR=sinAcosB+cosAsinB.\sin(A + B) = \frac{TR}{OR} = \frac{TS + SR}{OR} = \frac{PQ}{OR} + \frac{SR}{OR} = \frac{PQ}{OQ} \cdot \frac{OQ}{OR} + \frac{SR}{QR} \cdot \frac{QR}{OR} = \sin A\cos B + \cos A\sin B .
ABAOPQRTS
Figure 5.30. The construction for sin(A+B)\sin(A + B) when AA and BB are acute.

Accepting at this stage that the formula is valid for all angles, it can be adapted to give the full set of compound angle identities.

  1. Replacing BB by B-B, and using cos(B)=cosB\cos(-B) = \cos B and sin(B)=sinB\sin(-B) = -\sin B, gives sin(AB)=sinAcosBcosAsinB\sin(A - B) = \sin A\cos B - \cos A\sin B.
  2. Replacing AA by π2A\dfrac{\pi}{2} - A in this identity, and using the complementary ratios, gives sin(π2(A+B))=cosAcosBsinAsinB\sin\left(\dfrac{\pi}{2} - (A + B)\right) = \cos A\cos B - \sin A\sin B, that is cos(A+B)=cosAcosBsinAsinB\cos(A + B) = \cos A\cos B - \sin A\sin B.
  3. Replacing BB by B-B in this identity gives cos(AB)=cosAcosB+sinAsinB\cos(A - B) = \cos A\cos B + \sin A\sin B.
  4. Dividing sin(A+B)\sin(A + B) by cos(A+B)\cos(A + B), and then dividing the numerator and the denominator by cosAcosB\cos A\cos B, gives tan(A+B)=tanA+tanB1tanAtanB\tan(A + B) = \dfrac{\tan A + \tan B}{1 - \tan A\tan B}.
  5. Replacing BB by B-B in this identity, with tan(B)=tanB\tan(-B) = -\tan B, gives tan(AB)=tanAtanB1+tanAtanB\tan(A - B) = \dfrac{\tan A - \tan B}{1 + \tan A\tan B}.

Collating these results we have

sin(A+B)=sinAcosB+cosAsinB,sin(AB)=sinAcosBcosAsinB,cos(A+B)=cosAcosBsinAsinB,cos(AB)=cosAcosB+sinAsinB,tan(A+B)=tanA+tanB1tanAtanB,tan(AB)=tanAtanB1+tanAtanB.\begin{aligned} \sin(A + B) &= \sin A\cos B + \cos A\sin B, & \sin(A - B) &= \sin A\cos B - \cos A\sin B, \\ \cos(A + B) &= \cos A\cos B - \sin A\sin B, & \cos(A - B) &= \cos A\cos B + \sin A\sin B, \\ \tan(A + B) &= \frac{\tan A + \tan B}{1 - \tan A\tan B}, & \tan(A - B) &= \frac{\tan A - \tan B}{1 + \tan A\tan B} . \end{aligned}

The similarity between the pairs of identities for A+BA + B and ABA - B makes it clear that care must be taken with signs when using these formulae.

Example 5.40.

Without using a calculator, evaluate sin75\sin 75^\circ, cos105\cos 105^\circ and tan(15)\tan(-15^\circ).

sin75=sin(45+30)=sin45cos30+cos45sin30=1232+1212=3+122,cos105=cos(60+45)=cos60cos45sin60sin45=12123212=1322,tan(15)=tan(4560)=tan45tan601+tan45tan60=131+3=32,\begin{aligned} \sin 75^\circ &= \sin(45^\circ + 30^\circ) = \sin 45^\circ\cos 30^\circ + \cos 45^\circ\sin 30^\circ = \frac{1}{\sqrt2} \cdot \frac{\sqrt3}{2} + \frac{1}{\sqrt2} \cdot \frac12 = \frac{\sqrt3 + 1}{2\sqrt2}, \\ \cos 105^\circ &= \cos(60^\circ + 45^\circ) = \cos 60^\circ\cos 45^\circ - \sin 60^\circ\sin 45^\circ = \frac12 \cdot \frac{1}{\sqrt2} - \frac{\sqrt3}{2} \cdot \frac{1}{\sqrt2} = \frac{1 - \sqrt3}{2\sqrt2}, \\ \tan(-15^\circ) &= \tan(45^\circ - 60^\circ) = \frac{\tan 45^\circ - \tan 60^\circ}{1 + \tan 45^\circ\tan 60^\circ} = \frac{1 - \sqrt3}{1 + \sqrt3} = \sqrt3 - 2, \end{aligned}

the last after rationalising the denominator. The value of cos105\cos 105^\circ is negative, which is consistent with the cosine of an angle in the second quadrant. In each part there are alternative compound angles which could be used, such as 75=1204575^\circ = 120^\circ - 45^\circ, 105=15045105^\circ = 150^\circ - 45^\circ and 15=3045-15^\circ = 30^\circ - 45^\circ.

Example 5.41.

AA is obtuse and sinA=35\sin A = \frac35, and BB is acute and sinB=1213\sin B = \frac{12}{13}. Without finding the values of AA and BB, evaluate cos(A+B)\cos(A + B) and tan(AB)\tan(A - B).

In order to use the compound angle formulae we need cosA\cos A, cosB\cos B, tanA\tan A and tanB\tan B. These are most simply obtained by using Pythagoras in the appropriate right-angled triangles, with sides 33, 44, 55 and 55, 1212, 1313, remembering that AA is obtuse:

cosA=45,tanA=34,cosB=513,tanB=125.\cos A = -\frac45, \quad \tan A = -\frac34, \qquad \cos B = \frac{5}{13}, \quad \tan B = \frac{12}{5} .

Then

cos(A+B)=cosAcosBsinAsinB=(45)(513)(35)(1213)=5665,tan(AB)=tanAtanB1+tanAtanB=341251+(34)(125)=6316.\begin{aligned} \cos(A + B) &= \cos A\cos B - \sin A\sin B = \left(-\frac45\right)\left(\frac{5}{13}\right) - \left(\frac35\right)\left(\frac{12}{13}\right) = -\frac{56}{65}, \\ \tan(A - B) &= \frac{\tan A - \tan B}{1 + \tan A\tan B} = \frac{-\frac34 - \frac{12}{5}}{1 + \left(-\frac34\right)\left(\frac{12}{5}\right)} = \frac{63}{16} . \end{aligned}

Example 5.42.

Show that

sin(AB)cosAcosB+sin(BC)cosBcosC+sin(CA)cosCcosA=0.\frac{\sin(A - B)}{\cos A\cos B} + \frac{\sin(B - C)}{\cos B\cos C} + \frac{\sin(C - A)}{\cos C\cos A} = 0 .

Expanding each numerator, the left-hand side becomes

sinAcosBcosAsinBcosAcosB+sinBcosCcosBsinCcosBcosC+sinCcosAcosCsinAcosCcosA,\frac{\sin A\cos B - \cos A\sin B}{\cos A\cos B} + \frac{\sin B\cos C - \cos B\sin C}{\cos B\cos C} + \frac{\sin C\cos A - \cos C\sin A}{\cos C\cos A},

which is

(tanAtanB)+(tanBtanC)+(tanCtanA)=0.(\tan A - \tan B) + (\tan B - \tan C) + (\tan C - \tan A) = 0 .

Example 5.43.

Solve the equation 2cosθ=sin(θ+30)2\cos\theta = \sin(\theta + 30^\circ), giving the general values of θ\theta.

It is very important to appreciate that this is not an identity: only certain values of θ\theta satisfy the equation.

2cosθ=sinθcos30+cosθsin30=32sinθ+12cosθ,2\cos\theta = \sin\theta\cos 30^\circ + \cos\theta\sin 30^\circ = \frac{\sqrt3}{2}\sin\theta + \frac12\cos\theta,

therefore

32cosθ=32sinθ,sotanθ=3.\frac32\cos\theta = \frac{\sqrt3}{2}\sin\theta, \qquad\text{so}\qquad \tan\theta = \sqrt3 .

The principal solution is θ=60\theta = 60^\circ, so the general solution is θ=180n+60\theta = 180n^\circ + 60^\circ.

Problem 5.13.

  1. Without using a calculator, evaluate cos80cos20+sin80sin20\cos 80^\circ\cos 20^\circ + \sin 80^\circ\sin 20^\circ and sin165\sin 165^\circ.
  2. Show that sin(A+B)cosAcosB=tanA+tanB\dfrac{\sin(A + B)}{\cos A\cos B} = \tan A + \tan B.
  3. Solve the equation sin(x+60)=cosx\sin(x + 60^\circ) = \cos x, giving the angles from 00^\circ to 360360^\circ.

Double Angle Identities

The compound angle formulae deal with any two angles AA and BB, so they can be used for two equal angles. Replacing BB by AA in the formulae for A+BA + B gives

sin2A=2sinAcosA,cos2A=cos2Asin2A,tan2A=2tanA1tan2A.\sin 2A = 2\sin A\cos A, \qquad \cos 2A = \cos^2 A - \sin^2 A, \qquad \tan 2A = \frac{2\tan A}{1 - \tan^2 A} .

The second of these can be expressed in several forms, because

cos2Asin2A=(1sin2A)sin2A=12sin2A,cos2Asin2A=cos2A(1cos2A)=2cos2A1.\cos^2 A - \sin^2 A = (1 - \sin^2 A) - \sin^2 A = 1 - 2\sin^2 A, \qquad \cos^2 A - \sin^2 A = \cos^2 A - (1 - \cos^2 A) = 2\cos^2 A - 1 .

Thus

cos2A=cos2Asin2A=12sin2A=2cos2A1,\cos 2A = \cos^2 A - \sin^2 A = 1 - 2\sin^2 A = 2\cos^2 A - 1,

and these alternative expressions can themselves be rearranged to give

2sin2A=1cos2A,2cos2A=1+cos2A.2\sin^2 A = 1 - \cos 2A, \qquad 2\cos^2 A = 1 + \cos 2A .

Complete familiarity with all the double angle formulae, including all the alternative forms of cos2A\cos 2A, is essential. They are probably the most useful of all the trigonometric identities for simplifying trigonometric functions.

Example 5.44.

Find the general solution of the equation cos2x+3sinx=2\cos 2x + 3\sin x = 2.

Using cos2x=12sin2x\cos 2x = 1 - 2\sin^2 x gives

12sin2x+3sinx=2,2sin2x3sinx+1=0,(2sinx1)(sinx1)=0,1 - 2\sin^2 x + 3\sin x = 2, \qquad 2\sin^2 x - 3\sin x + 1 = 0, \qquad (2\sin x - 1)(\sin x - 1) = 0,

so sinx=12\sin x = \frac12 or sinx=1\sin x = 1.

  1. For sinx=12\sin x = \frac12 the principal solution is x=π6x = \dfrac{\pi}{6}, and the general solution is x=2nπ+π6x = 2n\pi + \dfrac{\pi}{6} or x=(2n+1)ππ6x = (2n + 1)\pi - \dfrac{\pi}{6}.
  2. For sinx=1\sin x = 1 the principal solution is x=π2x = \dfrac{\pi}{2}, and the general solution is x=2nπ+π2x = 2n\pi + \dfrac{\pi}{2}.

The full solution is therefore x=2nπ+π6x = 2n\pi + \dfrac{\pi}{6}, (2n+1)ππ6(2n + 1)\pi - \dfrac{\pi}{6} or 2nπ+π22n\pi + \dfrac{\pi}{2}.

Example 5.45.

If tanθ=34\tan\theta = \frac34 and θ\theta is acute, find the values of tan2θ\tan 2\theta, tan4θ\tan 4\theta and tanθ2\tan\dfrac{\theta}{2}.

In this problem we use tan2A=2tanA1tan2A\tan 2A = \dfrac{2\tan A}{1 - \tan^2 A} for three cases.

A=θ:tan2θ=2×341916=247,A=2θ:tan4θ=2×247157649=336527.\begin{aligned} A = \theta: &\qquad \tan 2\theta = \frac{2 \times \frac34}{1 - \frac{9}{16}} = \frac{24}{7}, \\ A = 2\theta: &\qquad \tan 4\theta = \frac{2 \times \frac{24}{7}}{1 - \frac{576}{49}} = -\frac{336}{527} . \end{aligned}

For A=θ2A = \dfrac{\theta}{2}, writing t=tanθ2t = \tan\dfrac{\theta}{2},

2t1t2=34,8t=33t2,3t2+8t3=0,(3t1)(t+3)=0,\frac{2t}{1 - t^2} = \frac34, \qquad 8t = 3 - 3t^2, \qquad 3t^2 + 8t - 3 = 0, \qquad (3t - 1)(t + 3) = 0,

so t=13t = \frac13 or t=3t = -3. But θ\theta is acute, so θ2\dfrac{\theta}{2} is acute and its tangent is positive. Therefore tanθ2=13\tan\dfrac{\theta}{2} = \dfrac13.

Example 5.46.

Show that sin3A=3sinA4sin3A\sin 3A = 3\sin A - 4\sin^3 A.

sin3A=sin(2A+A)=sin2AcosA+cos2AsinA=2sinAcos2A+(12sin2A)sinA=2sinA(1sin2A)+sinA2sin3A=3sinA4sin3A.\begin{aligned} \sin 3A = \sin(2A + A) &= \sin 2A\cos A + \cos 2A\sin A = 2\sin A\cos^2 A + (1 - 2\sin^2 A)\sin A \\ &= 2\sin A(1 - \sin^2 A) + \sin A - 2\sin^3 A = 3\sin A - 4\sin^3 A . \end{aligned}

This is quite a useful identity, and it is worth remembering.

Example 5.47.

Eliminate θ\theta from the equations x=cos2θx = \cos 2\theta and y=secθy = \sec\theta.

Using cos2θ=2cos2θ1\cos 2\theta = 2\cos^2\theta - 1, and cosθ=1y\cos\theta = \dfrac{1}{y},

x=2y21,hence(x+1)y2=2.x = \frac{2}{y^2} - 1, \qquad\text{hence}\qquad (x + 1)y^2 = 2 .

This is a Cartesian equation, obtained by eliminating the parameter θ\theta from a pair of parametric equations.

Problem 5.14.

  1. Express as a single trigonometric ratio 2sin14cos142\sin 14^\circ\cos 14^\circ, 12sin2401 - 2\sin^2 40^\circ and 1+tanx1tanx\dfrac{1 + \tan x}{1 - \tan x}.
  2. Solve the equation cos2x=sinx\cos 2x = \sin x for angles in the range 0x3600^\circ \leqslant x \leqslant 360^\circ, and state the general solution.
  3. Show that cos3θ=4cos3θ3cosθ\cos 3\theta = 4\cos^3\theta - 3\cos\theta.

Identities and the Inverse Functions

The double angle and compound angle identities are often useful in simplifying expressions, or solving equations, which contain inverse trigonometric functions.

Example 5.48.

Find xx if arcsinx+arccosx2=5π6\arcsin x + \arccos\dfrac{x}{2} = \dfrac{5\pi}{6}.

Let arcsinx=θ\arcsin x = \theta, so that sinθ=x\sin\theta = x, and cosθ=1x2\cos\theta = \sqrt{1 - x^2} since π2θπ2-\dfrac{\pi}{2} \leqslant \theta \leqslant \dfrac{\pi}{2}. Let arccosx2=φ\arccos\dfrac{x}{2} = \varphi, so that cosφ=x2\cos\varphi = \dfrac{x}{2}, and sinφ=4x22\sin\varphi = \dfrac{\sqrt{4 - x^2}}{2} since 0φπ0 \leqslant \varphi \leqslant \pi. The given equation then becomes θ+φ=5π6\theta + \varphi = \dfrac{5\pi}{6}, so

sin(θ+φ)=12,sinθcosφ+cosθsinφ=12,\sin(\theta + \varphi) = \frac12, \qquad \sin\theta\cos\varphi + \cos\theta\sin\varphi = \frac12,

that is

x22+1x24x22=12,1x24x2=1x2.\frac{x^2}{2} + \frac{\sqrt{1 - x^2}\,\sqrt{4 - x^2}}{2} = \frac12, \qquad \sqrt{1 - x^2}\,\sqrt{4 - x^2} = 1 - x^2 .

Squaring both sides, and not cancelling 1x2\sqrt{1 - x^2}, which would lose solutions, gives

(1x2)(4x2)=(1x2)2,(1x2)[(4x2)(1x2)]=3(1x2)=0,(1 - x^2)(4 - x^2) = (1 - x^2)^2, \qquad (1 - x^2)\bigl[(4 - x^2) - (1 - x^2)\bigr] = 3(1 - x^2) = 0,

so x=±1x = \pm 1. But arcsin(1)=π2\arcsin(-1) = -\dfrac{\pi}{2} and arccos(12)=2π3\arccos\left(-\dfrac12\right) = \dfrac{2\pi}{3}, whose sum is π6\dfrac{\pi}{6}, so x=1x = -1 does not satisfy the given equation. The only solution is x=1x = 1.

Example 5.49.

Show that arctan3+2arctan2=π+arccot3\arctan 3 + 2\arctan 2 = \pi + \operatorname{arccot} 3.

Let θ=arctan3\theta = \arctan 3, so that tanθ=3\tan\theta = 3 and π4<θ<π2\dfrac{\pi}{4} < \theta < \dfrac{\pi}{2}, and let φ=arctan2\varphi = \arctan 2, so that tanφ=2\tan\varphi = 2 and π4<φ<π2\dfrac{\pi}{4} < \varphi < \dfrac{\pi}{2}. The left-hand side is then θ+2φ\theta + 2\varphi. Now

tan2φ=2×214=43,tan(θ+2φ)=tanθ+tan2φ1tanθtan2φ=34313(43)=535=13.\tan 2\varphi = \frac{2 \times 2}{1 - 4} = -\frac43, \qquad \tan(\theta + 2\varphi) = \frac{\tan\theta + \tan 2\varphi}{1 - \tan\theta\tan 2\varphi} = \frac{3 - \frac43}{1 - 3\left(-\frac43\right)} = \frac{\frac53}{5} = \frac13 .

But π4<θ<π2\dfrac{\pi}{4} < \theta < \dfrac{\pi}{2} and π4<φ<π2\dfrac{\pi}{4} < \varphi < \dfrac{\pi}{2} give 3π4<θ+2φ<3π2\dfrac{3\pi}{4} < \theta + 2\varphi < \dfrac{3\pi}{2}, and the only angle in this range with tangent 13\frac13 is π+arctan13\pi + \arctan\frac13. So

arctan3+2arctan2=π+arctan13=π+arccot3.\arctan 3 + 2\arctan 2 = \pi + \arctan\frac13 = \pi + \operatorname{arccot} 3 .

Example 5.50.

Simplify arctanx+arctan1x1+x\arctan x + \arctan\dfrac{1 - x}{1 + x}, where x>1x > -1.

Let α=arctanx\alpha = \arctan x and β=arctan1x1+x\beta = \arctan\dfrac{1 - x}{1 + x}, so that tanα=x\tan\alpha = x and tanβ=1x1+x\tan\beta = \dfrac{1 - x}{1 + x}, and we have to simplify α+β\alpha + \beta. Using tan(α+β)=tanα+tanβ1tanαtanβ\tan(\alpha + \beta) = \dfrac{\tan\alpha + \tan\beta}{1 - \tan\alpha\tan\beta} gives

tan(α+β)=x+1x1+x1x1x1+x=x+x2+1x1+xx+x2=1.\tan(\alpha + \beta) = \frac{x + \dfrac{1 - x}{1 + x}}{1 - x \cdot \dfrac{1 - x}{1 + x}} = \frac{x + x^2 + 1 - x}{1 + x - x + x^2} = 1 .

Since x>1x > -1, both xx and 1x1+x\dfrac{1 - x}{1 + x} are greater than 1-1, so α\alpha and β\beta each lie between π4-\dfrac{\pi}{4} and π2\dfrac{\pi}{2}, and α+β\alpha + \beta lies between π2-\dfrac{\pi}{2} and π\pi. The only angle in that range whose tangent is 11 is π4\dfrac{\pi}{4}. Thus

arctanx+arctan1x1+x=π4.\arctan x + \arctan\frac{1 - x}{1 + x} = \frac{\pi}{4} .

Problem 5.15.

  1. Show that arctan13+arctan12=π4\arctan\dfrac13 + \arctan\dfrac12 = \dfrac{\pi}{4}.
  2. Solve the equation arctan(1+x)+arctan(1x)=arctan2\arctan(1 + x) + \arctan(1 - x) = \arctan 2.
  3. Simplify sin(2arctanx)\sin(2\arctan x).

The Half Angle Identities

We already know that tan2A=2tanA1tan2A\tan 2A = \dfrac{2\tan A}{1 - \tan^2 A}. Dividing sin2A=2sinAcosA\sin 2A = 2\sin A\cos A and cos2A=cos2Asin2A\cos 2A = \cos^2 A - \sin^2 A by cos2A+sin2A\cos^2 A + \sin^2 A, which is 11, and then dividing the numerator and the denominator by cos2A\cos^2 A, gives also

sin2A=2tanA1+tan2A,cos2A=1tan2A1+tan2A.\sin 2A = \frac{2\tan A}{1 + \tan^2 A}, \qquad \cos 2A = \frac{1 - \tan^2 A}{1 + \tan^2 A} .

If we replace 2A2A by θ\theta and use tt to denote tanθ2\tan\dfrac{\theta}{2}, we have

tanθ=2t1t2,sinθ=2t1+t2,cosθ=1t21+t2.\tan\theta = \frac{2t}{1 - t^2}, \qquad \sin\theta = \frac{2t}{1 + t^2}, \qquad \cos\theta = \frac{1 - t^2}{1 + t^2} .

These three identities allow all the trigonometric ratios of any one angle to be expressed in terms of a common variable tt. In problems where none of the identities used so far can be applied, this group can be helpful.

Example 5.51.

Solve the equation sinθ+2cosθ=1\sin\theta + 2\cos\theta = 1 for angles between 00^\circ and 360360^\circ.

With t=tanθ2t = \tan\dfrac{\theta}{2},

2t1+t2+2(1t2)1+t2=1,2t+22t2=1+t2,3t22t1=0,(3t+1)(t1)=0.\frac{2t}{1 + t^2} + \frac{2(1 - t^2)}{1 + t^2} = 1, \qquad 2t + 2 - 2t^2 = 1 + t^2, \qquad 3t^2 - 2t - 1 = 0, \qquad (3t + 1)(t - 1) = 0 .

Therefore either tanθ2=13\tan\dfrac{\theta}{2} = -\dfrac13 or tanθ2=1\tan\dfrac{\theta}{2} = 1. The range of values specified for θ\theta is 00^\circ to 360360^\circ, so the range of values required for θ2\dfrac{\theta}{2} is 00^\circ to 180180^\circ. Within this range tanθ2=13\tan\dfrac{\theta}{2} = -\dfrac13 gives θ2=161.57\dfrac{\theta}{2} = 161.57^\circ, and tanθ2=1\tan\dfrac{\theta}{2} = 1 gives θ2=45\dfrac{\theta}{2} = 45^\circ. Thus θ=323.13,90\theta = 323.13^\circ, 90^\circ.

Extra care is sometimes needed with this method, as a very similar equation shows. Consider

sinθcosθ=1.\sin\theta - \cos\theta = 1 .

Using t=tanθ2t = \tan\dfrac{\theta}{2} gives

2t1+t21t21+t2=1,2t1+t2=1+t2.\frac{2t}{1 + t^2} - \frac{1 - t^2}{1 + t^2} = 1, \qquad 2t - 1 + t^2 = 1 + t^2 .

The two t2t^2 terms cancel, leaving 2t=22t = 2, so t=1t = 1. But t=tanθ2t = \tan\dfrac{\theta}{2} is not defined when θ2\dfrac{\theta}{2} is an odd multiple of π2\dfrac{\pi}{2}, that is when θ=(2n+1)π\theta = (2n + 1)\pi, and these angles have to be checked separately: sinπcosπ=0+1=1\sin\pi - \cos\pi = 0 + 1 = 1, so they are solutions as well. Hence tanθ2=1\tan\dfrac{\theta}{2} = 1, or tanθ2\tan\dfrac{\theta}{2} is undefined, giving

θ2=nπ+π4orθ2=nπ+π2,that isθ=2nπ+π2orθ=(2n+1)π.\frac{\theta}{2} = n\pi + \frac{\pi}{4} \quad\text{or}\quad \frac{\theta}{2} = n\pi + \frac{\pi}{2}, \qquad\text{that is}\qquad \theta = 2n\pi + \frac{\pi}{2} \quad\text{or}\quad \theta = (2n + 1)\pi .

Remark.

When the half angle identities are used, tt does not always represent tanθ2\tan\dfrac{\theta}{2}. For instance, in solving the equation sin4θ+tan2θ=0\sin 4\theta + \tan 2\theta = 0 we would use t=tan2θt = \tan 2\theta.

The Expression acosθ+bsinθa\cos\theta + b\sin\theta

It is often useful to reduce acosθ+bsinθa\cos\theta + b\sin\theta to a single term such as rcos(θα)r\cos(\theta - \alpha). This is possible provided that we can find values of rr and α\alpha for which

r(cosθcosα+sinθsinα)=acosθ+bsinθr(\cos\theta\cos\alpha + \sin\theta\sin\alpha) = a\cos\theta + b\sin\theta

for every θ\theta. Comparing the coefficients of cosθ\cos\theta and of sinθ\sin\theta,

rcosα=a,rsinα=b.r\cos\alpha = a, \qquad r\sin\alpha = b .

Squaring and adding gives r2=a2+b2r^2 = a^2 + b^2, so rr is equal to the length of the hypotenuse of the triangle containing α\alpha with sides aa and bb, and dividing gives tanα=ba\tan\alpha = \dfrac{b}{a}, with α\alpha in the quadrant given by the signs of aa and bb. Thus

acosθ+bsinθ=rcos(θα),wherer=a2+b2andtanα=ba.a\cos\theta + b\sin\theta = r\cos(\theta - \alpha), \qquad\text{where}\qquad r = \sqrt{a^2 + b^2} \quad\text{and}\quad \tan\alpha = \frac{b}{a} .

Example 5.52.

Express 3cosθ+4sinθ3\cos\theta + 4\sin\theta in the form rcos(θα)r\cos(\theta - \alpha), giving the values of rr and α\alpha.

Let

r(cosθcosα+sinθsinα)=3cosθ+4sinθ,r(\cos\theta\cos\alpha + \sin\theta\sin\alpha) = 3\cos\theta + 4\sin\theta,

so that rcosα=3r\cos\alpha = 3 and rsinα=4r\sin\alpha = 4. Thus r=5r = 5 and tanα=43\tan\alpha = \dfrac43, which gives α=53.13\alpha = 53.13^\circ, and

3cosθ+4sinθ=5cos(θ53.13).3\cos\theta + 4\sin\theta = 5\cos(\theta - 53.13^\circ) .

It is sometimes more convenient to begin by comparing acosθ+bsinθa\cos\theta + b\sin\theta with rsin(θ+α)r\sin(\theta + \alpha), so that

r(sinθcosα+cosθsinα)=acosθ+bsinθ,rsinα=a,rcosα=b.r(\sin\theta\cos\alpha + \cos\theta\sin\alpha) = a\cos\theta + b\sin\theta, \qquad r\sin\alpha = a, \quad r\cos\alpha = b .

Then tanα=ab\tan\alpha = \dfrac{a}{b} and r=a2+b2r = \sqrt{a^2 + b^2}. The value of α\alpha is not the same as it was when we used rcos(θα)r\cos(\theta - \alpha). Further variations that could be used are rsin(θα)r\sin(\theta - \alpha) and rcos(θ+α)r\cos(\theta + \alpha). When using this method it is better to work from the basic comparison each time, as in the example above, than to quote values of rr and α\alpha.

Problem 5.16.

  1. Express 5cosθ+12sinθ5\cos\theta + 12\sin\theta in the forms rcos(θα)r\cos(\theta - \alpha) and rsin(θ+α)r\sin(\theta + \alpha).
  2. Express 3sinθ+4cosθ3\sin\theta + 4\cos\theta in the forms rsin(θ+α)r\sin(\theta + \alpha) and rcos(θα)r\cos(\theta - \alpha).
  3. Express 3cosθsinθ\sqrt3\cos\theta - \sin\theta in the form rcos(θ+α)r\cos(\theta + \alpha).

The Graph of acosθ+bsinθa\cos\theta + b\sin\theta

First consider the function f(θ)=kcosθf(\theta) = k\cos\theta, where k>0k > 0, which has the following characteristics.

  1. f(θ)=0f(\theta) = 0 when θ=π2,3π2,5π2,\theta = \dfrac{\pi}{2}, \dfrac{3\pi}{2}, \dfrac{5\pi}{2}, \ldots.
  2. f(θ)=kf(\theta) = k when θ=0,2π,4π,\theta = 0, 2\pi, 4\pi, \ldots.
  3. f(θ)=kf(\theta) = -k when θ=π,3π,5π,\theta = \pi, 3\pi, 5\pi, \ldots.

So the graph of this function is very similar to a standard cosine curve, but has maximum and minimum values ±k\pm k; we say that the curve has an amplitude of kk. We also saw that the graph of cos(θα)\cos(\theta - \alpha) is given by moving the graph of cosθ\cos\theta a distance α\alpha to the right. Combining these two modifications of a standard cosine curve, the graph of the function f(θ)=kcos(θα)f(\theta) = k\cos(\theta - \alpha) can be sketched.

−5−115θπ/2π3π/25 cos θ−3−113θπ/32π/3π4π/35π/3αkk cos(θ − α), drawn with k = 3 and α = π/3
Figure 5.31. A cosine curve with amplitude 55, and a cosine curve with amplitude kk moved a distance α\alpha to the right.

Consider now the function acosθ+bsinθa\cos\theta + b\sin\theta. At first sight its graph is not easy to visualise, but using acosθ+bsinθ=rcos(θα)a\cos\theta + b\sin\theta = r\cos(\theta - \alpha) we see that its graph is a cosine curve modified in two ways.

  1. Its maximum and minimum values are ±r\pm r, that is its amplitude is rr.
  2. Its position is a distance α\alpha to the right of the standard curve.

Example 5.53.

Sketch the graph of the function 3cosθ+4sinθ3\cos\theta + 4\sin\theta from 180-180^\circ to 180180^\circ.

As in the last example, 3cosθ+4sinθ=rcos(θα)3\cos\theta + 4\sin\theta = r\cos(\theta - \alpha) with r=5r = 5 and tanα=43\tan\alpha = \dfrac43, so α=53.13\alpha = 53.13^\circ. Hence the graph is a cosine curve with an amplitude of 55 and a phase shift of 53.1353.13^\circ to the right.

−180°−90°90°180°θ−55(53.13°, 5)
Figure 5.32. The graph of 3cosθ+4sinθ3\cos\theta + 4\sin\theta, with cosθ\cos\theta dashed.

It is interesting to see how the same graph is produced if the alternative form 3cosθ+4sinθ=rsin(θ+α)3\cos\theta + 4\sin\theta = r\sin(\theta + \alpha') is used. With this approach r=5r = 5 and tanα=34\tan\alpha' = \dfrac34, so that 3cosθ+4sinθ=5sin(θ+α)3\cos\theta + 4\sin\theta = 5\sin(\theta + \alpha'), and the graph is a sine curve with an amplitude of 55 and a displacement of α\alpha' to the left. But since tanα=cotα\tan\alpha' = \cot\alpha, the angles α\alpha' and α\alpha are complementary, that is α+α=π2\alpha + \alpha' = \dfrac{\pi}{2}. We also know that a cosine curve is the same as a sine curve displaced π2\dfrac{\pi}{2} to the left. So a cosine curve moved a distance α\alpha to the right coincides with a sine curve moved a distance α\alpha' to the left.

So any correct compound angle form of acosθ+bsinθa\cos\theta + b\sin\theta gives a quick method of sketching the graph of that function, and in particular of finding its maximum and minimum values, which for sine and cosine functions are also the greatest and least values.

The Equation acosθ+bsinθ=ca\cos\theta + b\sin\theta = c

One way of solving an equation of this type, using the half angle formulae, has already been used. A compound angle form gives an alternative method. Applied to the equation sinθ+2cosθ=1\sin\theta + 2\cos\theta = 1, solved above with tt, it gives

2cosθ+sinθ=r(cosθcosα+sinθsinα)=rcos(θα),2\cos\theta + \sin\theta = r(\cos\theta\cos\alpha + \sin\theta\sin\alpha) = r\cos(\theta - \alpha),

where rcosα=2r\cos\alpha = 2 and rsinα=1r\sin\alpha = 1, that is tanα=12\tan\alpha = \frac12 and r=5r = \sqrt5. Hence

5cos(θα)=1,cos(θα)=15,θα=360n±63.43,\sqrt5\cos(\theta - \alpha) = 1, \qquad \cos(\theta - \alpha) = \frac{1}{\sqrt5}, \qquad \theta - \alpha = 360n^\circ \pm 63.43^\circ,

from which θ=360n±63.43+α\theta = 360n^\circ \pm 63.43^\circ + \alpha. But α=arctan12=26.57\alpha = \arctan\frac12 = 26.57^\circ, so θ=360n+90\theta = 360n^\circ + 90^\circ or θ=360n36.87\theta = 360n^\circ - 36.87^\circ. Using the values of nn which give θ\theta between 00^\circ and 360360^\circ, that is n=0n = 0 and n=1n = 1, we have θ=90,323.13\theta = 90^\circ, 323.13^\circ.

Example 5.54.

Express 1sin2θ1+sin2θ\sqrt{\dfrac{1 - \sin 2\theta}{1 + \sin 2\theta}} in terms of tanθ\tan\theta.

Using sin2θ=2t1+t2\sin 2\theta = \dfrac{2t}{1 + t^2}, where t=tanθt = \tan\theta, gives

1sin2θ=1+t22t1+t2=(1t)21+t2,1+sin2θ=1+t2+2t1+t2=(1+t)21+t2.1 - \sin 2\theta = \frac{1 + t^2 - 2t}{1 + t^2} = \frac{(1 - t)^2}{1 + t^2}, \qquad 1 + \sin 2\theta = \frac{1 + t^2 + 2t}{1 + t^2} = \frac{(1 + t)^2}{1 + t^2} .

Hence

1sin2θ1+sin2θ=(1t)2(1+t)2,so1sin2θ1+sin2θ=±1tanθ1+tanθ,\frac{1 - \sin 2\theta}{1 + \sin 2\theta} = \frac{(1 - t)^2}{(1 + t)^2}, \qquad\text{so}\qquad \sqrt{\frac{1 - \sin 2\theta}{1 + \sin 2\theta}} = \pm\frac{1 - \tan\theta}{1 + \tan\theta},

taking the sign which makes the right-hand side positive.

Example 5.55.

Find the general solution of the equation cosθ3sinθ=1\cos\theta - \sqrt3\sin\theta = 1, first by using the half angle formulae and then by using a compound angle form.

  1. With t=tanθ2t = \tan\dfrac{\theta}{2}, the equation becomes 1t223t1+t2=1\dfrac{1 - t^2 - 2\sqrt3\,t}{1 + t^2} = 1, so 1t223t=1+t21 - t^2 - 2\sqrt3\,t = 1 + t^2, that is 2t(t+3)=02t(t + \sqrt3) = 0. Hence either t=0t = 0 or t=3t = -\sqrt3, and the principal values of θ2\dfrac{\theta}{2} are 00 and π3-\dfrac{\pi}{3}. So θ2=nπ\dfrac{\theta}{2} = n\pi or θ2=nππ3\dfrac{\theta}{2} = n\pi - \dfrac{\pi}{3}, and θ=2nπ\theta = 2n\pi or θ=2nπ2π3\theta = 2n\pi - \dfrac{2\pi}{3}. When tt is undefined, θ=(2n+1)π\theta = (2n + 1)\pi, the left-hand side is 1-1, so no solutions are lost.
  2. Let cosθ3sinθ=r(cosθcosαsinθsinα)=rcos(θ+α)\cos\theta - \sqrt3\sin\theta = r(\cos\theta\cos\alpha - \sin\theta\sin\alpha) = r\cos(\theta + \alpha), where rcosα=1r\cos\alpha = 1 and rsinα=3r\sin\alpha = \sqrt3. Then tanα=3\tan\alpha = \sqrt3, so α=π3\alpha = \dfrac{\pi}{3} and r=2r = 2, and the equation can be written 2cos(θ+π3)=12\cos\left(\theta + \dfrac{\pi}{3}\right) = 1. The principal value of θ+π3\theta + \dfrac{\pi}{3} is π3\dfrac{\pi}{3}, so θ+π3=2nπ±π3\theta + \dfrac{\pi}{3} = 2n\pi \pm \dfrac{\pi}{3}, and again θ=2nπ\theta = 2n\pi or θ=2nπ2π3\theta = 2n\pi - \dfrac{2\pi}{3}.

Example 5.56.

Express 5sinθ+12cosθ5\sin\theta + 12\cos\theta in the form rsin(θ+α)r\sin(\theta + \alpha), giving the values of rr and α\alpha. Show that 5sinθ+12cosθ+7205\sin\theta + 12\cos\theta + 7 \leqslant 20, and find the minimum value of 5sinθ+12cosθ+75\sin\theta + 12\cos\theta + 7. Sketch the graph of the function 15sinθ+12cosθ\dfrac{1}{5\sin\theta + 12\cos\theta} for 0θ2π0 \leqslant \theta \leqslant 2\pi.

Let 5sinθ+12cosθ=r(sinθcosα+cosθsinα)=rsin(θ+α)5\sin\theta + 12\cos\theta = r(\sin\theta\cos\alpha + \cos\theta\sin\alpha) = r\sin(\theta + \alpha), so that rcosα=5r\cos\alpha = 5 and rsinα=12r\sin\alpha = 12, giving r=13r = 13 and tanα=125\tan\alpha = \dfrac{12}{5}, α=67.38\alpha = 67.38^\circ. Hence

5sinθ+12cosθ=13sin(θ+α).5\sin\theta + 12\cos\theta = 13\sin(\theta + \alpha) .

But 1sin(θ+α)1-1 \leqslant \sin(\theta + \alpha) \leqslant 1, so 135sinθ+12cosθ13-13 \leqslant 5\sin\theta + 12\cos\theta \leqslant 13, and adding 77 throughout gives

65sinθ+12cosθ+720.-6 \leqslant 5\sin\theta + 12\cos\theta + 7 \leqslant 20 .

This shows that 5sinθ+12cosθ+7205\sin\theta + 12\cos\theta + 7 \leqslant 20, and that the minimum value of 5sinθ+12cosθ+75\sin\theta + 12\cos\theta + 7 is 6-6.

Now 5sinθ+12cosθ=13sin(θ+α)5\sin\theta + 12\cos\theta = 13\sin(\theta + \alpha), so the graph of 15sinθ+12cosθ\dfrac{1}{5\sin\theta + 12\cos\theta} is also the graph of 113cosec(θ+α)\dfrac{1}{13}\operatorname{cosec}(\theta + \alpha). Its general shape is a typical cosecant curve, except that its branches turn at the values 113\dfrac{1}{13} and 113-\dfrac{1}{13}, and its position is a distance α\alpha to the left of the standard curve.

θπ/2π3π/21/13−1/13
Figure 5.33. The graph of 15sinθ+12cosθ\dfrac{1}{5\sin\theta + 12\cos\theta} for 0θ2π0 \leqslant \theta \leqslant 2\pi.

Problem 5.17.

  1. Using t=tanθ2t = \tan\dfrac{\theta}{2}, solve the equation 3cosθ+2sinθ=33\cos\theta + 2\sin\theta = 3, giving the values of θ\theta from 180-180^\circ to 180180^\circ.
  2. Find the maximum and minimum values of 7cosθ24sinθ+37\cos\theta - 24\sin\theta + 3, and the values of θ\theta between 00^\circ and 360360^\circ at which they occur.
  3. Find the general solution of the equation cosx+sinx=2\cos x + \sin x = \sqrt2.

The Factor Formulae

To factorise is to express in the form of a product. The set of identities called the factor formulae converts expressions such as sinA+sinB\sin A + \sin B into a product. To derive them we use the compound angle group. Adding and subtracting

sinAcosB+cosAsinB=sin(A+B),sinAcosBcosAsinB=sin(AB)\sin A\cos B + \cos A\sin B = \sin(A + B), \qquad \sin A\cos B - \cos A\sin B = \sin(A - B)

gives the first two of the following identities, and similar treatment of cos(A+B)\cos(A + B) and cos(AB)\cos(A - B) gives the other two:

2sinAcosB=sin(A+B)+sin(AB),(1)2cosAsinB=sin(A+B)sin(AB),(2)2cosAcosB=cos(A+B)+cos(AB),(3)2sinAsinB=cos(A+B)cos(AB).(4)\begin{aligned} 2\sin A\cos B &= \sin(A + B) + \sin(A - B), &\qquad &(1) \\ 2\cos A\sin B &= \sin(A + B) - \sin(A - B), & &(2) \\ 2\cos A\cos B &= \cos(A + B) + \cos(A - B), & &(3) \\ -2\sin A\sin B &= \cos(A + B) - \cos(A - B). & &(4) \end{aligned}

Putting A+B=PA + B = P and AB=QA - B = Q, so that A=P+Q2A = \dfrac{P + Q}{2} and B=PQ2B = \dfrac{P - Q}{2}, these become

sinP+sinQ=2sinP+Q2cosPQ2,(5)sinPsinQ=2cosP+Q2sinPQ2,(6)cosP+cosQ=2cosP+Q2cosPQ2,(7)cosPcosQ=2sinP+Q2sinPQ2.(8)\begin{aligned} \sin P + \sin Q &= 2\sin\frac{P + Q}{2}\cos\frac{P - Q}{2}, &\qquad &(5) \\ \sin P - \sin Q &= 2\cos\frac{P + Q}{2}\sin\frac{P - Q}{2}, & &(6) \\ \cos P + \cos Q &= 2\cos\frac{P + Q}{2}\cos\frac{P - Q}{2}, & &(7) \\ \cos P - \cos Q &= -2\sin\frac{P + Q}{2}\sin\frac{P - Q}{2}. & &(8) \end{aligned}

Identities (5)(5) to (8)(8) are best used when a sum or difference is to be expressed as a product, while identities (1)(1) to (4)(4) should be used when a given product is to be changed into a sum or difference. For example, to express sin6θsin4θ\sin 6\theta - \sin 4\theta as a product we use (6)(6):

sin6θsin4θ=2cos6θ+4θ2sin6θ4θ2=2cos5θsinθ.\sin 6\theta - \sin 4\theta = 2\cos\frac{6\theta + 4\theta}{2}\sin\frac{6\theta - 4\theta}{2} = 2\cos 5\theta\sin\theta .

But to express 2cos7θcos2θ2\cos 7\theta\cos 2\theta as a sum we use (3)(3):

2cos7θcos2θ=cos(7θ+2θ)+cos(7θ2θ)=cos9θ+cos5θ.2\cos 7\theta\cos 2\theta = \cos(7\theta + 2\theta) + \cos(7\theta - 2\theta) = \cos 9\theta + \cos 5\theta .

When these identities are used regularly they are not too difficult to remember. Most people find it best to memorise them in words rather than as symbols. For example, (5)(5) can be remembered as “the sum of two sines is twice the sine of the semi-sum times the cosine of the semi-difference”, and (1)(1) as “twice sin cos is the sine of the sum plus the sine of the difference”. Identities (4)(4) and (8)(8) need special care because of the minus sign.

Example 5.57.

Show that sinA+sinBcosA+cosB=tanA+B2\dfrac{\sin A + \sin B}{\cos A + \cos B} = \tan\dfrac{A + B}{2}. If AA, BB and CC are the angles of a triangle, deduce that sinA+sinBcosA+cosB=cotC2\dfrac{\sin A + \sin B}{\cos A + \cos B} = \cot\dfrac{C}{2}.

Considering the left-hand side, by (5)(5) and (7)(7),

sinA+sinBcosA+cosB=2sinA+B2cosAB22cosA+B2cosAB2=tanA+B2.\frac{\sin A + \sin B}{\cos A + \cos B} = \frac{2\sin\frac{A + B}{2}\cos\frac{A - B}{2}}{2\cos\frac{A + B}{2}\cos\frac{A - B}{2}} = \tan\frac{A + B}{2} .

If AA, BB and CC are the angles of a triangle, A+B+C=180A + B + C = 180^\circ, so A+B2+C2=90\dfrac{A + B}{2} + \dfrac{C}{2} = 90^\circ. The angles A+B2\dfrac{A + B}{2} and C2\dfrac{C}{2} are complementary, therefore tanA+B2=cotC2\tan\dfrac{A + B}{2} = \cot\dfrac{C}{2}, and

sinA+sinBcosA+cosB=cotC2.\frac{\sin A + \sin B}{\cos A + \cos B} = \cot\frac{C}{2} .

Example 5.58.

Solve the equation sin5xsin3x=0\sin 5x - \sin 3x = 0, giving the general solution.

By (6)(6),

sin5xsin3x=2cos5x+3x2sin5x3x2=2cos4xsinx=0,\sin 5x - \sin 3x = 2\cos\frac{5x + 3x}{2}\sin\frac{5x - 3x}{2} = 2\cos 4x\sin x = 0,

so either cos4x=0\cos 4x = 0 or sinx=0\sin x = 0. If cos4x=0\cos 4x = 0, then 4x=(2n+1)π24x = (2n + 1)\dfrac{\pi}{2}, and if sinx=0\sin x = 0, then x=nπx = n\pi. The general solution is therefore

x=(2n+1)π8orx=nπ.x = (2n + 1)\frac{\pi}{8} \qquad\text{or}\qquad x = n\pi .

Example 5.59.

Factorise cosθcos3θcos5θ+cos7θ\cos\theta - \cos 3\theta - \cos 5\theta + \cos 7\theta.

Grouping the terms in pairs,

(cos7θ+cosθ)(cos5θ+cos3θ)=2cos4θcos3θ2cos4θcosθ=2cos4θ(cos3θcosθ),(\cos 7\theta + \cos\theta) - (\cos 5\theta + \cos 3\theta) = 2\cos 4\theta\cos 3\theta - 2\cos 4\theta\cos\theta = 2\cos 4\theta\,(\cos 3\theta - \cos\theta),

and by (8)(8), cos3θcosθ=2sin2θsinθ\cos 3\theta - \cos\theta = -2\sin 2\theta\sin\theta. So

cosθcos3θcos5θ+cos7θ=4cos4θsin2θsinθ.\cos\theta - \cos 3\theta - \cos 5\theta + \cos 7\theta = -4\cos 4\theta\sin 2\theta\sin\theta .

Other groupings of the four terms can be used, but arranging them so that pairs of cosines are added makes the factorising simplest.

Example 5.60.

If AA, BB and CC are the angles of a triangle, show that sinA+sinB+sinC=4cosA2cosB2cosC2\sin A + \sin B + \sin C = 4\cos\dfrac{A}{2}\cos\dfrac{B}{2}\cos\dfrac{C}{2}.

Now A+B+C=180A + B + C = 180^\circ, so A+B2=90C2\dfrac{A + B}{2} = 90^\circ - \dfrac{C}{2}, and therefore sinA+B2=cosC2\sin\dfrac{A + B}{2} = \cos\dfrac{C}{2} and sinC2=cosA+B2\sin\dfrac{C}{2} = \cos\dfrac{A + B}{2}. Considering the left-hand side, and using (5)(5) and the double angle formula for sinC\sin C,

sinA+sinB+sinC=2sinA+B2cosAB2+2sinC2cosC2=2cosC2cosAB2+2cosA+B2cosC2=2cosC2[cosAB2+cosA+B2].\begin{aligned} \sin A + \sin B + \sin C &= 2\sin\frac{A + B}{2}\cos\frac{A - B}{2} + 2\sin\frac{C}{2}\cos\frac{C}{2} \\ &= 2\cos\frac{C}{2}\cos\frac{A - B}{2} + 2\cos\frac{A + B}{2}\cos\frac{C}{2} \\ &= 2\cos\frac{C}{2}\left[\cos\frac{A - B}{2} + \cos\frac{A + B}{2}\right] . \end{aligned}

But by (7)(7), cosAB2+cosA+B2=2cosA2cosB2\cos\dfrac{A - B}{2} + \cos\dfrac{A + B}{2} = 2\cos\dfrac{A}{2}\cos\dfrac{B}{2}, so

sinA+sinB+sinC=4cosA2cosB2cosC2.\sin A + \sin B + \sin C = 4\cos\frac{A}{2}\cos\frac{B}{2}\cos\frac{C}{2} .

Problem 5.18.

  1. Factorise sin3A+sinA\sin 3A + \sin A and cos7AcosA\cos 7A - \cos A.
  2. Solve the equation cos2x+cos4x=0\cos 2x + \cos 4x = 0, giving the values of xx from 00^\circ to 360360^\circ.
  3. If AA, BB and CC are the angles of a triangle, show that cos(B+C)=cosA\cos(B + C) = -\cos A and that cosA+cosB+cosC=1+4sinA2sinB2sinC2\cos A + \cos B + \cos C = 1 + 4\sin\dfrac{A}{2}\sin\dfrac{B}{2}\sin\dfrac{C}{2}.

Small Angles

A glance at the values of sinθ\sin\theta and tanθ\tan\theta when θ\theta is a very small positive angle shows that these two ratios are almost equal. Further, if the small angle is measured in radians, both are found to be almost equal to θ\theta. These relationships can be demonstrated as follows.

Consider a small angle θ\theta, measured in radians, subtended by an arc ABAB at the centre OO of a circle of radius rr. The area of the sector OABOAB is 12r2θ\frac12 r^2\theta. If ACAC is drawn perpendicular to OAOA, to cut OBOB produced at CC, then OACOAC is a right-angled triangle with base rr and height rtanθr\tan\theta, so its area is 12r2tanθ\frac12 r^2\tan\theta. Further, when the chord ABAB is drawn, an isosceles triangle OABOAB is formed with base rr and height rsinθr\sin\theta, so its area is 12r2sinθ\frac12 r^2\sin\theta.

OABCθr
Figure 5.34. The triangle OABOAB, the sector OABOAB and the triangle OACOAC.

Now area of triangle OAB<OAB < area of sector OAB<OAB < area of triangle OACOAC, that is

12r2sinθ<12r2θ<12r2tanθ.\tfrac12 r^2\sin\theta < \tfrac12 r^2\theta < \tfrac12 r^2\tan\theta .

Dividing throughout by 12r2\frac12 r^2, which is positive, gives sinθ<θ<tanθ\sin\theta < \theta < \tan\theta. But sinθ\sin\theta, θ\theta and tanθ\tan\theta are all positive, since θ\theta is a small positive angle, so we can divide throughout by any of them. Dividing by sinθ\sin\theta,

1<θsinθ<secθ.1 < \frac{\theta}{\sin\theta} < \sec\theta .

For small values of θ\theta, secθ1\sec\theta \to 1 as θ0\theta \to 0. Hence as θ0\theta \to 0, θsinθ\dfrac{\theta}{\sin\theta} lies between 11 and a number which approaches 11, and we can say that θsinθ1\dfrac{\theta}{\sin\theta} \to 1 as θ0\theta \to 0, a limit in the sense of the last lesson. Similarly, by dividing the first inequalities by tanθ\tan\theta, we get cosθ<θtanθ<1\cos\theta < \dfrac{\theta}{\tan\theta} < 1, which shows that θtanθ1\dfrac{\theta}{\tan\theta} \to 1 as θ0\theta \to 0.

The same results are obtained if θ\theta is a small negative angle, since θsinθ\dfrac{\theta}{\sin\theta} and θtanθ\dfrac{\theta}{\tan\theta} are unchanged when θ\theta is replaced by θ-\theta. These limiting values show that, for small values of θ\theta,

sinθθandtanθθ.\sin\theta \approx \theta \qquad\text{and}\qquad \tan\theta \approx \theta .

So far we have not found an approximate value for cosθ\cos\theta when θ\theta is small. To do this we use the double angle identity

cosθ=12sin2θ2.\cos\theta = 1 - 2\sin^2\frac{\theta}{2} .

If θ\theta is small then so is θ2\dfrac{\theta}{2}, and sinθ2θ2\sin\dfrac{\theta}{2} \approx \dfrac{\theta}{2}, so cosθ12(θ2)2=1θ22\cos\theta \approx 1 - 2\left(\dfrac{\theta}{2}\right)^2 = 1 - \dfrac{\theta^2}{2}.

Thus, when θ\theta is measured in radians,

limθ0sinθθ=1andlimθ0tanθθ=1,\lim_{\theta \to 0}\frac{\sin\theta}{\theta} = 1 \qquad\text{and}\qquad \lim_{\theta \to 0}\frac{\tan\theta}{\theta} = 1,

and for any small angle θ\theta, measured in radians,

sinθθ,tanθθ,cosθ1θ22.\sin\theta \approx \theta, \qquad \tan\theta \approx \theta, \qquad \cos\theta \approx 1 - \frac{\theta^2}{2} .

These approximations are correct to three significant figures for angles in the range 0.105θ0.105-0.105 \leqslant \theta \leqslant 0.105, that is about 6θ6-6^\circ \leqslant \theta \leqslant 6^\circ.

Example 5.61.

Find an approximation for the expression sin3θ1+cos2θ\dfrac{\sin 3\theta}{1 + \cos 2\theta} when θ\theta is small.

When θ\theta is small, 3θ3\theta is small, so sin3θ3θ\sin 3\theta \approx 3\theta; also 2θ2\theta is small, so cos2θ1(2θ)22=12θ2\cos 2\theta \approx 1 - \dfrac{(2\theta)^2}{2} = 1 - 2\theta^2. So when θ\theta is small,

sin3θ1+cos2θ3θ22θ2.\frac{\sin 3\theta}{1 + \cos 2\theta} \approx \frac{3\theta}{2 - 2\theta^2} .

Example 5.62.

Without using a calculator, find an approximate value for tan61\tan 61^\circ, given that 3=1.732\sqrt3 = 1.732 and 1=0.0171^\circ = 0.017 radians, giving the answer to three decimal places.

tan61=tan(60+1)=tan60+tan11tan60tan1=3+tan113tan1.\tan 61^\circ = \tan(60^\circ + 1^\circ) = \frac{\tan 60^\circ + \tan 1^\circ}{1 - \tan 60^\circ\tan 1^\circ} = \frac{\sqrt3 + \tan 1^\circ}{1 - \sqrt3\tan 1^\circ} .

Now tanθθ\tan\theta \approx \theta when θ\theta is small and measured in radians, so tan10.017\tan 1^\circ \approx 0.017. Hence

tan611.732+0.0171(1.732)(0.017)=1.802.\tan 61^\circ \approx \frac{1.732 + 0.017}{1 - (1.732)(0.017)} = 1.802 .

Problem 5.19.

  1. If θ\theta is small, find approximations for θsinθ1cosθ\dfrac{\theta\sin\theta}{1 - \cos\theta} and sin4θθ\dfrac{\sin 4\theta}{\theta}.
  2. If θ\theta is small enough for θ2\theta^2 to be neglected, show that tan(π4+θ)1+θ1θ\tan\left(\dfrac{\pi}{4} + \theta\right) \approx \dfrac{1 + \theta}{1 - \theta}.

Further Properties of Triangles

There is a great variety of relationships between the sides and angles of a triangle besides the sine and cosine rules, and some of the most useful can be derived from the identities above.

The Cotangent Formula

If DD divides the side ABAB of a triangle ABCABC in the ratio m:nm : n then, with the angles marked in Figure 5.35,

(m+n)cotθ=mcotαncotβ.(m + n)\cot\theta = m\cot\alpha - n\cot\beta .

This relationship is known as the cotangent formula, and we show it by using the sine rule in the triangles ACDACD and BCDBCD. In the triangle ACDACD the angle at DD is 180θ180^\circ - \theta, so the angle AA is θα\theta - \alpha, and

CDsinA=ADsinα,CD=ADsin(θα)sinα.\frac{CD}{\sin A} = \frac{AD}{\sin\alpha}, \qquad CD = \frac{AD\sin(\theta - \alpha)}{\sin\alpha} .

In the triangle BCDBCD the angle BB is 180θβ180^\circ - \theta - \beta, so sinB=sin(θ+β)\sin B = \sin(\theta + \beta), and

CDsinB=BDsinβ,CD=BDsin(θ+β)sinβ.\frac{CD}{\sin B} = \frac{BD}{\sin\beta}, \qquad CD = \frac{BD\sin(\theta + \beta)}{\sin\beta} .

Hence

ADsin(θα)sinα=BDsin(θ+β)sinβ.\frac{AD\sin(\theta - \alpha)}{\sin\alpha} = \frac{BD\sin(\theta + \beta)}{\sin\beta} .

But AD:DB=m:nAD : DB = m : n, so

msin(θα)sinα=nsin(θ+β)sinβ,that ism(sinθcosαcosθsinα)sinα=n(sinθcosβ+cosθsinβ)sinβ.\frac{m\sin(\theta - \alpha)}{\sin\alpha} = \frac{n\sin(\theta + \beta)}{\sin\beta}, \qquad\text{that is}\qquad \frac{m(\sin\theta\cos\alpha - \cos\theta\sin\alpha)}{\sin\alpha} = \frac{n(\sin\theta\cos\beta + \cos\theta\sin\beta)}{\sin\beta} .

Dividing both sides by sinθ\sin\theta gives

m(cotαcotθ)=n(cotβ+cotθ),so(m+n)cotθ=mcotαncotβ.m(\cot\alpha - \cot\theta) = n(\cot\beta + \cot\theta), \qquad\text{so}\qquad (m + n)\cot\theta = m\cot\alpha - n\cot\beta .

If DD is the midpoint of ABAB, this becomes 2cotθ=cotαcotβ2\cot\theta = \cot\alpha - \cot\beta.

ABDCθαβmn
Figure 5.35. The angles in the cotangent formula, with AD:DB=m:nAD : DB = m : n.

Other Relationships

The Projection Formula

In any triangle ABCABC,

c=bcosA+acosB.c = b\cos A + a\cos B .

When AA and BB are acute, the perpendicular from CC to ABAB divides ABAB into two parts of lengths bcosAb\cos A and acosBa\cos B, as in Figure 5.36. If one of the angles is obtuse, say BB, the foot of the perpendicular lies beyond BB, and the part acosBa\cos B is negative, so the formula still holds.

The Difference of Two Sides

In any triangle ABCABC,

aba+b=tanAB2tanC2.\frac{a - b}{a + b} = \tan\frac{A - B}{2}\tan\frac{C}{2} .

We show this by using the sine rule in the form asinA=bsinB=k\dfrac{a}{\sin A} = \dfrac{b}{\sin B} = k, say, so that a=ksinAa = k\sin A and b=ksinBb = k\sin B. Hence, by the factor formulae,

aba+b=k(sinAsinB)k(sinA+sinB)=2cosA+B2sinAB22sinA+B2cosAB2=tanAB2cotA+B2.\frac{a - b}{a + b} = \frac{k(\sin A - \sin B)}{k(\sin A + \sin B)} = \frac{2\cos\frac{A + B}{2}\sin\frac{A - B}{2}}{2\sin\frac{A + B}{2}\cos\frac{A - B}{2}} = \tan\frac{A - B}{2}\cot\frac{A + B}{2} .

But A+B+C=πA + B + C = \pi, so A+B2=π2C2\dfrac{A + B}{2} = \dfrac{\pi}{2} - \dfrac{C}{2}, and cotA+B2=tanC2\cot\dfrac{A + B}{2} = \tan\dfrac{C}{2}. So

aba+b=tanAB2tanC2.\frac{a - b}{a + b} = \tan\frac{A - B}{2}\tan\frac{C}{2} .

The Bisector of an Angle

In a triangle ABCABC the bisector of the angle AA divides BCBC in the ratio c:bc : b.

We show this by letting the bisector meet BCBC at DD, with the angle ADBADB equal to θ\theta. In the triangle ABDABD,

BDsin12A=csinθ,\frac{BD}{\sin\frac12 A} = \frac{c}{\sin\theta},

and in the triangle ACDACD, where the angle at DD is 180θ180^\circ - \theta,

DCsin12A=bsin(180θ)=bsinθ.\frac{DC}{\sin\frac12 A} = \frac{b}{\sin(180^\circ - \theta)} = \frac{b}{\sin\theta} .

Hence

sin12Asinθ=BDc=DCb,soBD:DC=c:b.\frac{\sin\frac12 A}{\sin\theta} = \frac{BD}{c} = \frac{DC}{b}, \qquad\text{so}\qquad BD : DC = c : b .
ABCb cos Aa cos Bbac = b cos A + a cos BABCDcbthe bisector of the angle A
Figure 5.36. The perpendicular from CC divides ABAB into bcosAb\cos A and acosBa\cos B; the bisector ADAD divides BCBC in the ratio c:bc : b.

Points Associated with a Triangle

The following geometric properties of a triangle should also be familiar.

  1. The perpendicular bisectors of the sides of a triangle ABCABC meet at a point called the circumcentre, which is the centre of the circle through AA, BB and CC, the circumcircle. Its radius is the RR of the sine rule.
  2. The bisectors of the angles AA, BB and CC meet at a point called the incentre, which is the centre of the circle that touches all three sides, the inscribed circle.
  3. The altitudes meet at a point HH called the orthocentre.
  4. The medians meet at a point GG called the centroid.
ABCOcircumcentre OABCIincentre IABCHorthocentre HABCGcentroid G
Figure 5.37. The circumcentre, incentre, orthocentre and centroid of a triangle.

The Area of a Triangle

The area of a triangle can be found using any of the following.

  1. Half the base times the perpendicular height.
  2. 12absinC\frac12 ab\sin C, or the corresponding 12bcsinA\frac12 bc\sin A and 12casinB\frac12 ca\sin B. This follows from the first, since the height of AA above the side CBCB, of length aa, is bsinCb\sin C.
  3. s(sa)(sb)(sc)\sqrt{s(s - a)(s - b)(s - c)}, where s=12(a+b+c)s = \frac12(a + b + c), which we accept here.

Example 5.63.

In a surveying exercise, PP and QQ are two points on land which is inaccessible. To find the distance PQPQ, a line ABAB of length 200200 metres is drawn so that PP and QQ are on opposite sides of ABAB. The following angles are measured:

ABP=60,ABQ=46,BAP=30,BAQ=67.\angle ABP = 60^\circ, \qquad \angle ABQ = 46^\circ, \qquad \angle BAP = 30^\circ, \qquad \angle BAQ = 67^\circ .

Find the distance PQPQ.

In the triangle APBAPB, APB=90\angle APB = 90^\circ, hence AP=200cos30=173.2AP = 200\cos 30^\circ = 173.2 m. In the triangle ABQABQ, AQB=67\angle AQB = 67^\circ, hence

AQsin46=200sin67,AQ=156.3 m.\frac{AQ}{\sin 46^\circ} = \frac{200}{\sin 67^\circ}, \qquad AQ = 156.3 \text{ m}.

Then in the triangle APQAPQ, where PAQ=30+67=97\angle PAQ = 30^\circ + 67^\circ = 97^\circ, the cosine rule gives

PQ2=AP2+AQ22APAQcos97=173.22+156.322(173.2)(156.3)(0.1219),PQ^2 = AP^2 + AQ^2 - 2 \cdot AP \cdot AQ\cos 97^\circ = 173.2^2 + 156.3^2 - 2(173.2)(156.3)(-0.1219),

hence PQ=247PQ = 247 m.

ABPQ30°60°67°46°200 m
Figure 5.38. The baseline ABAB and the inaccessible points PP and QQ.

Example 5.64.

In a triangle ABCABC, BC=7.4BC = 7.4 cm, AC=4.1AC = 4.1 cm and ACB=66\angle ACB = 66^\circ. Calculate the other angles of the triangle, the area of the triangle, and the distance of the incentre II of the triangle from BCBC.

  1. Using the cosine rule, c2=7.42+4.122(7.4)(4.1)cos66c^2 = 7.4^2 + 4.1^2 - 2(7.4)(4.1)\cos 66^\circ gives c=6.85c = 6.85 cm. Then the sine rule, 7.4sinA=4.1sinB=6.85sin66\dfrac{7.4}{\sin A} = \dfrac{4.1}{\sin B} = \dfrac{6.85}{\sin 66^\circ}, gives A=80.8A = 80.8^\circ and B=33.2B = 33.2^\circ; AA is acute since a2<b2+c2a^2 < b^2 + c^2.
  2. The area of the triangle is 12absinC=12(7.4)(4.1)sin66=13.86 cm2\frac12 ab\sin C = \frac12(7.4)(4.1)\sin 66^\circ = 13.86\ \text{cm}^2.
  3. The incentre II is the centre of the inscribed circle, and is therefore at the same distance rr from all three sides. Joining AIAI, BIBI and CICI divides the triangle into three triangles, AIBAIB, BICBIC and CIACIA, with areas 12cr\frac12 cr, 12ar\frac12 ar and 12br\frac12 br. So the total area of the triangle ABCABC is 12r(a+b+c)=9.175r\frac12 r(a + b + c) = 9.175r. But this area is 13.86 cm213.86\ \text{cm}^2, hence the distance of II from BCBC is r=1.5r = 1.5 cm.
IrABCcab
Figure 5.39. The incentre II at the distance rr from each side, dividing the triangle into three.

Problem 5.20.

  1. Calculate the area of the triangle whose sides are 1111, 1010 and 1515.
  2. In a triangle PQRPQR, p=2.8p = 2.8 m and q=4.5q = 4.5 m. If the area of the triangle is 5.84 m25.84\ \text{m}^2, find the two possible values of rr.
  3. Show that, for any triangle ABCABC, abc=4ΔRabc = 4\Delta R, where Δ\Delta is the area of the triangle and RR is the radius of its circumcircle.
  4. ABCABC is a triangle and DD is the point on BCBC for which BD=DCBD = DC. The angle BADBAD is 2020^\circ and the angle CADCAD is 3030^\circ. Find the angle ACBACB.

Exercises

Questions marked with an examining board are taken from past A-level papers: JMB is the Joint Matriculation Board, U of L the University of London, C Cambridge, and AEB the Associated Examining Board.

Exercise 5.1.

A chord of a circle subtends an angle of θ\theta radians at the centre of the circle. If the area of the minor segment cut off by the chord is one sixth of the area of the circle, show that

sinθ=θπ3.\sin\theta = \theta - \frac{\pi}{3} .

Exercise 5.2.

PP and QQ are points on a circle of radius rr, and the chord PQPQ subtends an angle of 2θ2\theta radians at the centre OO. If AA is the area enclosed by the minor arc PQPQ and the chord PQPQ, and BB is the area enclosed by the arc PQPQ and the tangents to the circle at PP and QQ, show that

AB=r2(2θtanθsinθcosθ).A - B = r^2(2\theta - \tan\theta - \sin\theta\cos\theta) .

Exercise 5.3.

Three cylinders are placed in contact with each other with their axes parallel. The radii of the cylinders are 33 cm, 44 cm and 55 cm. An elastic band is stretched round the three cylinders so that the plane of the band is perpendicular to the axes of the cylinders. Calculate the length of the part of the band in contact with the largest cylinder. (U of L)

Exercise 5.4.

Without the use of a calculator, find, for each of the following equations, all the solutions in the interval 0x1800^\circ \leqslant x \leqslant 180^\circ.

  1. cos(x+30)=cos(603x)\cos(x + 30^\circ) = \cos(60^\circ - 3x);
  2. sin(x+20)=cos3x\sin(x + 20^\circ) = \cos 3x. (JMB)

Exercise 5.5.

Find the general solution of the equation cos3x+cosx=sin2x\cos 3x + \cos x = \sin 2x. (U of L)

Exercise 5.6.

  1. If sin(θα)=ksin(θ+α)\sin(\theta - \alpha) = k\sin(\theta + \alpha), find tanθ\tan\theta in terms of tanα\tan\alpha and kk, and so determine the possible values of θ\theta between 00^\circ and 360360^\circ when k=12k = \frac12 and α=150\alpha = 150^\circ.
  2. Show, without the use of a calculator, that x=π10x = \dfrac{\pi}{10} satisfies the equation cos3x=sin2x\cos 3x = \sin 2x. By expressing this equation in terms of sinx\sin x and cosx\cos x, show that sinπ10\sin\dfrac{\pi}{10} is a root of the equation 4s2+2s1=04s^2 + 2s - 1 = 0. (C)

Exercise 5.7.

Find all the values of θ\theta in the range 0θ2π0 \leqslant \theta \leqslant 2\pi for which sinθ+sin3θ=cosθ+cos3θ\sin\theta + \sin 3\theta = \cos\theta + \cos 3\theta. (JMB)

Exercise 5.8.

Find, to the nearest minute, the acute angle α\alpha for which 4cosθ3sinθ=5cos(θ+α)4\cos\theta - 3\sin\theta = 5\cos(\theta + \alpha). Calculate the values of θ\theta in the interval 180<θ<180-180^\circ < \theta < 180^\circ for which the function f(θ)=4cosθ3sinθ4f(\theta) = 4\cos\theta - 3\sin\theta - 4 attains its greatest value, its least value and the value zero. (JMB)

Exercise 5.9.

  1. Show that (sin2θsinθ)(1+2cosθ)=sin3θ(\sin 2\theta - \sin\theta)(1 + 2\cos\theta) = \sin 3\theta.
  2. Find the values of xx between 00^\circ and 360360^\circ which satisfy the equation sinx+sin2x=sin3x\sin x + \sin 2x = \sin 3x. (C)

Exercise 5.10.

Show that secx+tanx=tan(π4+x2)\sec x + \tan x = \tan\left(\dfrac{\pi}{4} + \dfrac{x}{2}\right), and deduce a similar expression for secxtanx\sec x - \tan x. Hence find in surd form the values of tanπ12\tan\dfrac{\pi}{12} and tan5π12\tan\dfrac{5\pi}{12}. (AEB, 1975)

Exercise 5.11.

  1. Show that cos3θsin3θ=(cosθ+sinθ)(14cosθsinθ)\cos 3\theta - \sin 3\theta = (\cos\theta + \sin\theta)(1 - 4\cos\theta\sin\theta).
  2. Show that if secA=cosB+sinB\sec A = \cos B + \sin B, then tan2A=sin2B\tan^2 A = \sin 2B and cos2A=tan2(π4B)\cos 2A = \tan^2\left(\dfrac{\pi}{4} - B\right). (C)

Exercise 5.12.

By expressing sec2x\sec 2x and tan2x\tan 2x in terms of tanx\tan x, or otherwise, solve the equation 2tanx+sec2x=2tan2x2\tan x + \sec 2x = 2\tan 2x, giving all the solutions between 180-180^\circ and 180180^\circ. (U of L)

Exercise 5.13.

Express 3sinθcosθ\sqrt3\sin\theta - \cos\theta in the form Rsin(θα)R\sin(\theta - \alpha), where RR is positive. Find all the values of θ\theta in the range 0θ3600^\circ \leqslant \theta \leqslant 360^\circ which satisfy the equation 4sinθcosθ=3sinθcosθ4\sin\theta\cos\theta = \sqrt3\sin\theta - \cos\theta. (JMB)

Exercise 5.14.

  1. Show that (cotθ+cosecθ)2=1+cosθ1cosθ(\cot\theta + \operatorname{cosec}\theta)^2 = \dfrac{1 + \cos\theta}{1 - \cos\theta}, and hence, or otherwise, solve the equation (cot2θ+cosec2θ)2=sec2θ(\cot 2\theta + \operatorname{cosec} 2\theta)^2 = \sec 2\theta for values of θ\theta between 00^\circ and 180180^\circ.
  2. Find the general solution of the equation sin2x+sin3x+sin5x=0\sin 2x + \sin 3x + \sin 5x = 0. (AEB, 1973)

Exercise 5.15.

For θ≢π(mod2π)\theta\not\equiv\pi\pmod{2\pi}, use the formulae expressing sinθ\sin\theta and cosθ\cos\theta in terms of t=tanθ2t = \tan\dfrac{\theta}{2}, or otherwise, to show that

1+sinθ5+4cosθ=(1+t)29+t2.\frac{1 + \sin\theta}{5 + 4\cos\theta} = \frac{(1 + t)^2}{9 + t^2} .

Check the omitted values of θ\theta directly, and deduce that 01+sinθ5+4cosθ1090 \leqslant \dfrac{1 + \sin\theta}{5 + 4\cos\theta} \leqslant \dfrac{10}{9} for all values of θ\theta. (C)

Exercise 5.16.

  1. Show that cos4x+sin4x=112sin22x\cos^4 x + \sin^4 x = 1 - \frac12\sin^2 2x.
  2. Solve, for 0x1800^\circ \leqslant x \leqslant 180^\circ, the equation sinx+sin5x=sin3x\sin x + \sin 5x = \sin 3x.
  3. Find the general solution of the equation 3cosx+4sinx=23\cos x + 4\sin x = 2. (U of L)

Exercise 5.17.

Show that cosecθ+cotθ=cotθ2\operatorname{cosec}\theta + \cot\theta = \cot\dfrac{\theta}{2}. Hence

  1. deduce the values, in surd form, of cotπ8\cot\dfrac{\pi}{8} and cotπ12\cot\dfrac{\pi}{12};
  2. express cosecθ+cosec2θ+cosec4θ\operatorname{cosec}\theta + \operatorname{cosec} 2\theta + \operatorname{cosec} 4\theta as the difference of two cotangents;
  3. show, without using a calculator, that cosec4π15+cosec8π15+cosec16π15+cosec32π15=0\operatorname{cosec}\dfrac{4\pi}{15} + \operatorname{cosec}\dfrac{8\pi}{15} + \operatorname{cosec}\dfrac{16\pi}{15} + \operatorname{cosec}\dfrac{32\pi}{15} = 0. (C)

Exercise 5.18.

  1. Express 7sinx24cosx7\sin x - 24\cos x in the form Rsin(xα)R\sin(x - \alpha), where RR is positive and α\alpha is an acute angle. Hence, or otherwise, solve the equation 7sinx24cosx=157\sin x - 24\cos x = 15 for 0x3600^\circ \leqslant x \leqslant 360^\circ.
  2. Solve the simultaneous equations cosx+cosy=1\cos x + \cos y = 1 and secx+secy=4\sec x + \sec y = 4 for 0x1800^\circ \leqslant x \leqslant 180^\circ and 0y1800^\circ \leqslant y \leqslant 180^\circ. (AEB, 1976)

Exercise 5.19.

Express cos2xsin2x\cos 2x - \sin 2x in the form Rcos(2x+α)R\cos(2x + \alpha), giving the values of RR and α\alpha. Hence find the general solution of each of the following equations.

  1. cos2xsin2x=1\cos 2x - \sin 2x = 1;
  2. cos2xsin2x=2cos4x\cos 2x - \sin 2x = \sqrt2\cos 4x. (U of L)

Exercise 5.20.

  1. Find, in the range 180x180-180^\circ \leqslant x \leqslant 180^\circ, the solutions of the equation cos5x=cosx\cos 5x = \cos x.
  2. Show that 1+cosθ+sinθ1cosθ+sinθ=1+cosθsinθ\dfrac{1 + \cos\theta + \sin\theta}{1 - \cos\theta + \sin\theta} = \dfrac{1 + \cos\theta}{\sin\theta}. (JMB)

Exercise 5.21.

If sinθ+sin2θ+sin3θ+sin4θ=0\sin\theta + \sin 2\theta + \sin 3\theta + \sin 4\theta = 0, show that θ\theta is either a multiple of π2\dfrac{\pi}{2} or a multiple of 2π5\dfrac{2\pi}{5}. (U of L)

Exercise 5.22.

Write down the expansions of cos(A+B)\cos(A + B) and cos(AB)\cos(A - B) in terms of the cosines and sines of AA and BB.

  1. Find angles xx and yy, each between 00 and 9090^\circ, which satisfy the simultaneous equations cosxcosy=0.6\cos x\cos y = 0.6 and sinxsiny=0.2\sin x\sin y = 0.2.
  2. Show that cos3x=4cos3x3cosx\cos 3x = 4\cos^3 x - 3\cos x. Hence find all the solutions, in the range 180x180-180^\circ \leqslant x \leqslant 180^\circ, of the equation 2cos3x+cos2x+1=02\cos 3x + \cos 2x + 1 = 0. (JMB)

Exercise 5.23.

By means of the substitution tanθ=t\tan\theta = t, or otherwise, find the values of θ\theta in the range 0<θ<π20 < \theta < \dfrac{\pi}{2} such that

(2tanθ)(1+sin2θ)2=0.(2 - \tan\theta)(1 + \sin 2\theta) - 2 = 0 .

Show that, when θ\theta is small, (2tanθ)(1+sin2θ)23θ(2 - \tan\theta)(1 + \sin 2\theta) - 2 \approx 3\theta. (JMB)

Exercise 5.24.

A quadrilateral ABCDABCD is right-angled at BB and at DD, and the angle DABDAB is 132132^\circ. If DA=4DA = 4 and AB=7AB = 7, find the lengths of the diagonals of the quadrilateral and the radius of the inscribed circle of the triangle ABCABC. (U of L)

Exercise 5.25.

Three towns AA, BB and CC are all at sea level. The bearings of the towns BB and CC from AA, measured clockwise from north, are 3636^\circ and 247247^\circ respectively. If BB is 120120 km from AA and CC is 234234 km from AA, calculate the distance and the bearing of the town BB from CC. (AEB, 1972)

Check Yourself

 

Fresh questions on the whole chapter — none of them is worked out above. Do each on paper first; the box only tells you whether you got there.

Answers are checked in your browser, as often as you like. Nothing is sent anywhere and nothing is kept but your own work. A formula may be written with the symbols themselves or with ~ & | -> <-> ^, and \and, \or, \to expand as you type.

Exercise 5.26.

What is 150150^\circ in radians?

answer one of these

Exercise 5.27.

An arc of a circle of radius 66 cm subtends an angle of π3\dfrac{\pi}{3} at the centre. What is the length of the arc, in centimetres?

answer one of these

Exercise 5.28.

A sector of a circle of radius 44 cm contains an angle of 1.51.5 radians. What is its area, in square centimetres?

answer one of these

Exercise 5.29.

What is sin210\sin 210^\circ?

answer one of these

Exercise 5.30.

The angle θ\theta is obtuse and sinθ=45\sin\theta = \dfrac45. What is cosθ\cos\theta?

answer one of these

Exercise 5.31.

A triangle has sides 55, 77 and 88. What is the angle opposite the side of length 77?

answer one of these

Exercise 5.32.

In a triangle ABCABC, A=30A = 30^\circ, B=45B = 45^\circ and a=5a = 5. What is bb?

answer one of these

Exercise 5.33.

What is the period of the function θtan3θ\theta \mapsto \tan 3\theta?

answer one of these

Exercise 5.34.

What is arccos(12)\arccos\left(-\dfrac12\right)?

answer one of these

Exercise 5.35.

What is the general solution of tanθ=13\tan\theta = \dfrac{1}{\sqrt3}?

answer one of these

Exercise 5.36.

How many solutions has the equation sin2θ=12\sin 2\theta = \dfrac12 in the interval 0θ2π0 \leqslant \theta \leqslant 2\pi?

answer one of these

Exercise 5.37.

What is sin15cos15\sin 15^\circ\cos 15^\circ?

answer one of these

Exercise 5.38.

What is tan105\tan 105^\circ?

answer one of these

Exercise 5.39.

What is the greatest value of 3sinθ+4cosθ+13\sin\theta + 4\cos\theta + 1?

answer one of these

Exercise 5.40.

What is the area of the triangle with a=6a = 6, b=8b = 8 and C=30C = 30^\circ?

answer one of these

Exercise 5.41.

What is limθ0sin3θθ\displaystyle\lim_{\theta \to 0}\frac{\sin 3\theta}{\theta}, with θ\theta in radians?

answer one of these